Answer:
Step-by-step explanation:
sin(-430)=-sin(430)=-sin(360+70)=-sin 70
help on this please
Answer:
Opening: Opens upwards
Axis of Symmetry: -7/2
Vertex: (-7/2, -81/4)
X - intercepts: (1, 0) and (-8, 0)
Y - intercept: (0, -8)
Step-by-step explanation:
Opening: 'a' is greater than zero
Axis of Symmetry:
[tex]\frac{-7}{2(1)} =\frac{-7}{2}[/tex]
Vertex:
[tex]y= (\frac{-7}{2})^{2} +7(\frac{-7}{2}) -8\\y= (\frac{49}{4}) +(\frac{-49}{2}) -8\\y= \frac{49}{4} +\frac{-98}{4} -8\\y=\frac{-49}{4}-8\\y = \frac{-81}{4}[/tex]
X - intercepts:
(x-1)(x+8)
x = 1 and x = -8
Y - intercept: (0, -8)
[tex]y= 0^{2} +7(0) -8\\\\y= -8\\[/tex]
You have a square table and want to create a
tablecloth for it using a piece of fabric.
The side length of the table is 72 inches. How
much fabric do you need?
Based on the information given, the length of fabric that's needed will be 288 inches.
From the information given in the question, we are informed that the side length of the table is 72 inches. Therefore, in order to calculate the fabric needed, we have to find the perimeter and this goes thus:
= 72 inches × 4
= 288 inches.
Therefore, the length of fabric that's needed will be 288 inches.
Read related link on:
https://brainly.com/question/24429956
You read online that a 15 ft by 20 ft brick patio would cost about $2,275 to have professionally installed. Estimate the cost of having a 23 by 28 ft brick patio installed
Answer:
$4884 to the nearest $.
Step-by-step explanation:
By proportion it is 2275 * (23*28) / (15*20)
= $4884
NO LINKS!!!!! Please help me.
Absolute Maximum:
f(-3):
Absolute minimum:
Range:
Domain:
Is the graph a function?:
Relative Maximum(s):
Increasing Interval(s):
Decreasing Interval(s):
Relative minimum(s):
THIS IS NOT MULTIPLE CHOICE!!!
Answers:
Absolute maximum: 4f(-3) = -2Absolute minimum: Does not existRange: [tex](-\infty, 4][/tex]Domain: [tex][-4, \infty)[/tex]Is it a function? YesRelative Maximum(s): 2Increasing Interval(s): [tex](-2, 1)[/tex] ... interval notationDecreasing Interval(s): [tex](-\infty, -2) \ \cup \ (1, \infty)[/tex]Relative Minimum(s): -4=====================================================
Explanations:
The absolute maximum occurs at the highest point. Specifically, it's the largest y output possible. In this case, it's y = 4.
----------------
To determine the value of f(-3), we draw a vertical line through -3 on the x axis. Mark where this vertical line crosses the curve. Let's say its point P. From point P, draw a horizontal line until you reach the y axis. You should arrive at y = -2. Therefore, f(-3) = -2.
----------------
The absolute min is similar to the absolute max, but now we're looking at the lowest y output possible. No such y value exists because the curve goes on forever downward.
----------------
The range is the set of all possible y outputs. The range in compound inequality notation is [tex]-\infty < y \le 4[/tex] indicating y can be anything between negative infinity and 4. We can include 4. The range in interval notation is [tex](-\infty, 4][/tex]. Note the use of the square bracket so that we include the 4.
-----------------
The domain is the set of x inputs possible. The smallest such input allowed is x = -4. There is no largest input because the graph goes on forever to the right. The domain is any x value such that [tex]-4 \le x < \infty[/tex] which condenses to the interval notation [tex][-4, \infty)[/tex]
-----------------
This is a function because we cannot draw a single vertical line through more than one point on this curve; hence, this graph passes the vertical line test.
Put another way, any x input in the domain leads to exactly one and only one y output. This is a nonvisual way to prove we have a function.
-----------------
A relative maximum occurs at any peak or mountain region. It is relatively the highest point in the neighborhood/region of points. There's one such mountain peak and it's at (1,2). We can think of this as a vertex of sorts for an upside down parabola. So the relative max is y = 2 because we're only concerned with the y value.
Note: y = 4 is not a relative max because there aren't any points to the left of that endpoint. A relative extrema must have points to the left and right of it for it to be a valid neighborhood.
-----------------
Imagine this curve represents a roller coaster. As we move to the right, going uphill on this curve is an increasing section. That would be the interval from x = -2 to x = 1. So we'd say -2 < x < 1 which condenses to the interval notation (-2, 1). This is not to be confused with ordered pair (x,y) notation.
-----------------
Now we consider when we move downhill when we move to the right. This occurs on the intervals [tex]-\infty < x < -2[/tex] and also [tex]1 < x < \infty[/tex]. We don't include any of the endpoints. This is because at x = -2 and x = 1, the cart is neither moving uphill nor downhill. These locations are stationary resting points so to speak.
Those two inequalities mentioned convert to the interval notations [tex](-\infty, -2)[/tex] and [tex](1, \infty)[/tex] in that order.
Once we determined those separated disjoint regions, we glue them together with the use of the union symbol U.
Our answer for this part would be [tex](-\infty, -2) \ \cup \ (1, \infty)[/tex]. Any point in this collective region will be moving downhill when moving left to right.
-----------------
This is similar to a relative maximum, but this time we're looking at the lowest valley point of a certain neighborhood. This is at (-2,-4). Therefore, the relative min is y = -4.
How can you compare data sets?
When you compare two or more data sets, focus on four features:
Center. Graphically, the center of a distribution is the point where about half of the observations are on either side.
Spread. The spread of a distribution refers to the variability of the data. ...
Shape. ...
Unusual features.
Answer:
Common graphical displays (e.g., dotplots, boxplots, stemplots, bar charts) can be effective tools for comparing data from two or more data sets.
Step-by-step explanation:
MARK ME AS A BRAINLIST PLZ
Which word is a synonym of verify?
consent or confirm
Answer:
confirm is the correct answer
Plz mark as Brainliest
The cost of a meal is split evenly between Alania and her two friends. They determine that each person owes $14.68. How much was the entire cost of the meal?
Answer:
$44.04
Step-by-step explanation:
let 3 be the number of people and 14.68 the person owes
3*14.68 = 44.04
Can you help me with this? I’m stuck
Answer:
The answer is x^2 + 3^2
Step-by-step explanation:
Answer:
answer ::::: x^2 + 6x + 9
jim dog eats 11/3 bones in five days how many bones will the dog eat in 12 days
Answer:
The answer would be 44
Step-by-step explanation:
First, you have to simplify the improper fraction, that would make the it a mixed number which would be 3 2/3. When 3 2/3 is multiplied by 12 is 44. Hope this helps!
canh square roots be rational numbers ?
1) Eight times the difference between a number and seven, is the same as when five times
the number is increased by four. Find the number.
Tip: Go step-by-step
Let the number = x
Eight times the difference between a number and seven.. = 8(x-7)
is the same as... =
the number increased by 4.. x+4
8(x-7)=x+4
Distribute
8x-56=x+4
Subtract x from both sides
7x-56=4
Add 56 to both sides
7x=60
x=60/7
A rectangles has a length 2 ft less than three times its width what is the area of the rectangle when its width is 2 ft
Answer:
8
Step-by-step explanation:
rectangle length is 2-3w
w=2
3 x 2=6 - 2=4
l x w
4 x 2 =8
Please help!
Triangle ABC has angle measures as shown. Show work. Complete sentence.
(a) What is the value of x?
(b) What is the measure of angle CBA?
(c) What is the measure of angle CAB?
(d) When these 3 interior angles of a triangle are added together, what does it equal?
9514 1404 393
Answer:
(a) x = 22
(b) 46°
(c) 44°
(d) 180°
Step-by-step explanation:
Because the sum of the interior angles of a triangle is 180°, we know that the sum of the acute angles in a right triangle is 90°.
(a)The sum of the marked acute angles is 90°.
2x +(3x -20) = 90
5x = 110 . . . . . . . . . . add 20, collect terms
x = 22 . . . . . . . . . divide by 5
__
(b)∠CBA = (3x -20)° = (3·22 -20)° = 46°
__
(c)∠CAB = 2x° = 2(22)° = 44°
__
(d)The sum of a triangle's interior angles is 180°.
Solve the problems.
A bird is flying at an elevation of 14 feet above the
surface of the water. A fish is swimming the same
distance below the surface of the water.
How can you
represent a location
below the surface of
the water?
a. What number represents the position of the fish
relative to the surface of the water?
b. How does the absolute value of the number
you wrote show that the distances are the
same? Explain.
Answer:
I believe a is -14
Step-by-step explanation:
its -14 because if it is in the exact same spot below water, think of the water as point 0. the bird is 14 and the fish is -14. Hope this helped
Pls help and answer the question in the photo
Answer:
Cam
Step-by-step explanation:
Cam first multiplied both sides by 3 which removed the fraction on the left. They then correctly added 5 to both sides to get x on its own.
Hope this helps!
Consider the rational function:
f(3) = 22-53-6
22 +31-10
Which values are restrictions on the domain of f(x)?
theres also an answer option of x=5 but it wouldnt fit in the picture
2&3
Step-by-step explanation:
You have to factorise the second equation and you have to solve it. so you have x²-2x-3x+6
x(x-2)-3(x-2)
(x-2)(x-3)=0
Then you have to find x for each equation.
x-2=0
x=2
x-3=0
x=3
So the restricions are 2&3.
50,000 is 20% of what?
Answer:
250000
Step-by-step explanation:
20% of x is 50000
----------------------------
50000=20x/100
50000= x/5
5(50000) = x
250000 = x
c: how long does it take the snail to crawl 85 inches
NEED ANSWER ASAPP PLSSS
INCLUDES PICTURE OF GRAPH
Answer:
8 minutes, 30 seconds, by the look of the graph.
Step-by-step explanation:
At a distance of 10 inches, 1 minute has passed.
So multiply that by 8.5, and you have 85 inches travelled over 8 minutes, 30 seconds.
8mins and some 30secs according to the graph
Please answer both of them questions please no links or you will be reported
Find a point E on CD such that the ratio of CE to CD is [tex]\frac{3}{8}[/tex].
Answer:
Sorry if it’s wrong. But I think the answer is: -3
Step-by-step explanation:
Formula:
E= x1 + a/b (x2 -x1)
E=-9 + 3/8(7+9)
E= -9 + 3/8(16)
E= -9 + 6
E= -3
The location of point E will be at negative 3. Then the correct option is C.
What is the section of the line?Let A (x₁, y₁) and B (x₂, y₂) be a line segment. Then the point P (x, y) divides the line segment in the ratio of m:n. Then we have
x = (mx₂ + nx₁) / (m + n)
y = (my₂ + ny₁) / (m + n)
The information is given below.
CE / CD = 3 / 8
CE / ED = 3 / 5 = m / n
Then the location of the point E will be
x = [3 × (7) + 5 × (-9)] / (3 + 5)
x = (21 - 45) / 8
x = - 24 / 8
x = -3
Thus, the location of point E will be at negative 3. Then the correct option is C.
More about the section of the line link is given below.
https://brainly.com/question/6582647
If the radius of circle C is double the radius of circle D, what can you say is true to the area of circle C?
Answer:quadrupled
Step-by-step explanation:
If the radius of a circle is doubled, the area of the circle will be quadrupled and the circumference will also be doubled. This makes sense because the area of a circle is directly proportional to the square of the radius of the circle (if the radius of a circle is increased x times, its area will be increased to x^2 times the original area), whereas the circumference is proportional to the size of the radius (if the radius of a circle is increased x times, its circumference will increase x times).
there are 9 acorns in each pile. there are 8 piles. how many acorns are there in all? write an equation that can be used to solve this problem
Answer:
72 acorns.
Step-by-step explanation:
9 (acorns per pile)
*
8 (piles)
Answer:
9x8=72 making the answer 72 acorns in total.
Please help me with number 8
Answer:
jjejejkwkwkqkkqkqkqkkqkqkq
Can you answer number 7
Answer:
x= 62
Step-by-step explanation:
brainliest please
Please help please help please help please help
For your question you can try option #3
Our material handlers make $15 per hour, and it takes them about 15 minutes to complete this process. How much is our handling cost?
Answer: $3.75
Step-by-step explanation: $15x15=225/60= 3.75
Our material handling cost is $3.75.
What is cost?A cost function is a mathematical formula used to used to chart how production expenses will change at different output levels.
How to find the cost per process?Material handlers make $15 per hour
If it takes them about 15 minutes to complete this process then process in an hour is 60/15 =4
The cost per process is 15/4 =3.75.
Learn more about cost here- brainly.com/question/25233348
#SPJ2
If 2+√3/2-√3= a+b√3 Find a and b
Answer:
a = 7, b = 4Step-by-step explanation:
Simplify the left side:
(2 + √3)/(2 - √3) = (2 + √3)(2 + √3)/(2 + √3)(2 - √3) =(4 + 4√3 + 3)/(4 - 3) =7 + 4√3Compare with the right side:
a = 7, b = 4Carl shades a row in the multiplication table the products in the row are all even the ones digits in the products repeat 0,4,8,2,6 what road does Carl shade?
Answer:
Carl shades the 4s row in the multiplication table.
Step-by-step explanation:
4, 8, 12, 16, 20, 24, 28, 32, 36, 40, 44, 48. This is the pattern 4, 8, 2, 6, 0, 4, 8, 2, 6, etc.
Need help pleaseee …
Answer:
2.5
Step-by-step explanation:
By Pythagoras theorem,
Hypotenuse = √( 4^2 + 3^2 )
= √( 16 + 9 )
= √25
Hypotenuse = 5
4 / 2 = 5 / x
2 = 5 / x
x = 5 / 2
x = 2.5
A true/false test has 20 questions on it. What is the probability that you get at least 18 right by purely guessing?
Answer:
I would say if your lucky 6/20 but if not 4/10