Gabe's bill at Colton's was $25. If he decided to leave his server a 20% tip, how muc
money did he spend in all?

Answers

Answer 1

Answer:

$31.25

Step-by-step explanation:

If I understood the question correctly, it should be $31.25. 25 x 0.25 (25 percent) = 6.25. 25 + 6.25 = 31.25.


Related Questions

Solve x/2- 8 = y for x. A. x= 1/2y

Answers

Answer:

x = 2y + 16

Step-by-step explanation:

Given equation:

x/2 - 8 = y

Solve for x:

x/2 = y + 8     ⇒ add 8 to both sidesx = 2y + 16     ⇒ multiple both sides by 2
>> Answer :

____________

[tex] \: [/tex]

[tex] \frac{x}{2 - 8} = y[/tex]

[tex] \frac{x}{2} = y + 8[/tex]

[tex]x = \bold{2y + 16}[/tex]

Find g(x) for each x value in the table

Answers

Answer:

-2 = -2/7

-1= -1/7

0=0

1= 1/7

2= 2/7

Step-by-step explanation:

it gives you a function of 1/7 so you multiply it by x and u get the g(x) also know as Y

25×2- (42÷6) + 18 can someone help me?

Answers

Answer:

The answer is 61

Answer:

61

Step-by-step explanation:

PLEASE HELP WITH THIS ONE QUESTION

Answers

Answer:

Where's The Answer Im Sorry I Didn't See Anything....m

Evaluate the function for each input listed in the table, and graph the resulting ordered pairs on the coordinate plane.

x f(x) = 2x
0
1
2
3
4

Answers

Answer:

0

2

4

6

8

Step-by-step explanation:

f(x) = 2x

f(0) = 2 * 0 = 0

f(1) = 2 * 1 = 2

f(2) = 2 * 2 = 4

f(3) = 2 * 3 = 6

f(4) = 2 * 4 = 8

The complete table of the linear function f(x) = 2x for x = 0 to 4 is:

x     0   1    2   3  4  

f(x)  0   2   4   6   8

How to evaluate the function values?

The function is given as:

f(x) = 2x

When x = 0, we have:

f(0) =2(0) = 1

When x = 1, we have:

f(1) =2(1) = 2

When x = 2, we have:

f(2) =2(2) = 4

When x = 3, we have:

f(3) =2(3) = 6

When x = 4, we have:

f(4) =2(4) = 8

So, the complete table is:

x     0   1    2   3  4  

f(x)  0   2   4   6   8

Read more about linear functions at:

https://brainly.com/question/14323743

A student would like to estimate the height of a statue. The length of the​ statue's right arm is 51 feet. The​ student's right arm is 2 feet long and her height is 5
1
3 feet. Use this information to estimate the height of the statue. How close is the approximate height to the​ statue's actual height of 135 ​feet, 3 inches from heel to top of​ head?


I got a.
13 feet

b. What is the difference between the appoximate height of the statue and its actual​ height?

Answers

Answer:

FEET

Step-by-step explanation:

Distance from earth to the moon is 238,900 . From earth to the sun is 92935,700 ,about how many times the distance from earth to the moon is distance from earth to the sun

Answers

Answer: the sun is 389.015069067 times further away from earth to the moon

Step-by-step explanation: 92935700/238990=389.015069067

What does 1/2 + 1/4 equal

Answers

3/4.
1/2 is the same thing as 2/4. 2/4 plus 1/4 equals 3/4

Answer:

0.75 as a decimal, and 3/4 as a fraction

Step-by-step explanation:

which of the following statements are true for sin (-430°)

i. the basic angle, a lies in the second quadrant
Ii. sin (-430°) = +sin (430°)
III. sin (-430°) = sin (70°)
iv. a = 30°​

Answers

Answer:

Step-by-step explanation:

sin(-430)=-sin(430)=-sin(360+70)=-sin 70

HELPPPPPPPP!!!! In 1.6, we learned about rational exponents. In a rational exponent, the numerator is the power that the base of the exponent is being raised to and the denominator is the root that is being taken of that base. If the numerator is odd, why is there only one root? ​

Answers

Because it is getting squared only once

The price of an item has dropped to $68 today. Yesterday it was $80. Find the percentage decrease.

Answers

Answer:

15 percent

Step-by-step explanation:

Answer:

15%

Step-by-step explanation:

(80-68)*(100/80)=15%

80 precent of games is 32 games

Answers

Answer:

If you are asking for the whole number of game it is 40

Step-by-step explanation:

Usian bolt can run 100meters in 9.58 seconds . my car can drive 100kilometers an hour. which is faster, is it faster to travel 100meters in 9.58 seconds or 100 kilometers an hour

Answers

Answer:

Your car is faster of course

Step-by-step explanation:

100 km would be 100000 meters. Then you would need to know that if Usain bolt ran 100 meters every 9.54 sec then in 100000 meters he would have ran 9540 seconds which is also known has 159 minutes, which is more than 1 hour so your car is faster.

Hello who here is good at math i need help
if you can help me with some assignments then please do

Answers

Answer:

sup

Step-by-step explanation:

whats your question

Answer the question below, and then fill in the blanks if necessary.
Can the distributive property be used to rewrite
3 x (8 + 4) ?
Yes
No
If yes, fill in the blanks below.
3 x (8 + 4) - (0 * D + xD
X 5
?

Answers

Answer:

yes

Step-by-step explanation:

3(8+4)

(3×8)+(3×4)

24+12

36

the ratio 4:2 is equivalent to 2

Answers

To make pastry for an apple pie, you need 4 oz flour and 2 oz fat. The ratio of flour to fat is

4 : 2 .

But this ratio can be simplified in the same way that two fractions can be simplified. We just

cancel by a common factor. So

4 : 2 = 2 : 1 .

HELP ME, THE MIDPOINT OF AB IS M (-4,-7). If the coordinates of A are (-7,-6) what are the coordinates of B?

Answers

Answer:

(-1,-8)

Step-by-step explanation:

Multiply each value of midpoint by 2 and take away given points coordinates

How to type a line above the number 6 on chromebook.

Answers

Answer:

you put in the number 6 but you leave room uptop so enter and then put 6 for the----- so in other words

-----

6

Which graph shows a system with one solution?

Answers

Answer: Graph A

Explanation:

A solution is where the lines intersect. Graph A shows exactly one solution, and it is at (-2,2)

Graph B doesn't have any solutions since the lines are parallel, and parallel lines never intersect. We consider this system to be inconsistent.

Graph C has infinitely many solutions. The two lines perfectly overlap, meaning there are infinitely many intersection points. All solutions here are of the form (x,y) = (x,2x-1)

Solve the following proportion problem. Round to two decimals as need.

2.4/x = 5

Answers

Step-by-step explanation:

If you mean, 2.4 divided by x equals 5,

and we're to find x,

x=2.4÷5

x=0.48

Hope this helps, If so mark BRAINLIEST please

Help Me Pls

1.Virgie will equally give P 742.60 among her 4 nephews. How much will each nephew get?

A. P 185.65
B. P 85.56
C. P 158.65
D. P185.55

2.Php 5876 are distributed equally among 26 men. How much money will each person
get?

D.P 262
C. P 262
B. P 226
A. P 225

3.Bernard wants to cut a straight board into 4 equal pieces. The board is 112.12 cm
long. How long should Bemard cut each piece?

D. 28.04
C. 28.03
B. 28.02
A. 28.01

4.When the in a basket is grouped into 2, 3 or 5, there is always an extra.

5.How many 25centavo coins are equal to P 5.00?
D. 18
C. 21
B. 19
A. 20​

Answers

The amount that will be gotten by each nephew when Virgie will equally give P 742.60 among her 4 nephews will be $185.65.

Since Virgie will equally give P 742.60 among her 4 nephews, the amount that each nephew gets will be:

= 742.60 / 4

= $185.65

If Php 5876 are distributed equally among 26 men, the amount that each person gets will be:

= Php 5876 / 26

= Php 226

If Bernard wants to cut a straight board into 4 equal pieces and the board is 112.12 cm, the length of each piece will be:

= 112.12cm / 4

= 28.03cm

The number of 25cents coins that are equal to P 5.00 will be:

= 5/0.25

= 20

There will be 20 25 cents coins on P5.00.

Read related link on:

https://brainly.com/question/25311950

Find the probability distribution for the following function: P(x) = (x/2)+1 for x = 4, 6, and 8

Answers

p(4)=(4/2)+1
=2+1
=3

p(6)=(6/2)+1
=3+1
=4

p(8)=(8/2)+1
=4+1
=5
not sure if this is what you ment but i hope this helped! :)

How to write 9 and 15 thousandths in decimals

Answers

Answer:

0.915

Step-by-step explanation:

The answer is 9.15, you are welcome

Prime numbers have, less than two factors, more than two factors, exactly two factors, less than or equal to two factors.​

Answers

Answer:

exactly 2

Step-by-step explanation:

Prime numbers, the way I was taught to answer this question, has less than 2 factors. The reason is that 1 is considered a factor. However, I think the definition has changed and a prime has exactly two factors -- 1 and itself. 11 is a prime number: only 11 and 1 will divide into it.

Answer:

C exactly two factors.

Step-by-step explanation:

its 2 factors since 1 is considered a factor and 11 is a prime number so it be 2.

Which side in the figure on the right corresponds to segment QS?
What is the scale factor?


See the picture

Please help

Answers

Since it was rotated the corresponding side is segment UV.

QS = 4 = original
UV = 2 = new
Scale factor = new/original = 2/4 = 0.5

A machine produces electrical components. 99.7% of the components have lengths between 1.176 cm and 1.224 cm. Assuming this data is normally distributed, what are the mean and standard deviation?

Answers

Hi how are you doing

Can you please tell me the answer please

Answers

Answer:

34°

Step-by-step explanation:

21x - 1 + 11x +1 + 26x + 6 = 180

58x -1 +1 +6 = 180

58x +6 = 180

58x = 174

x = 3

11 × 3 + 1 = 34

According to the laws of physics, the weights of objects on the Earth are proportional to their weights on the Moon. A boy who weighs 66 lb on Earth weighs 10.92 lb on the Moon. How much will a man who weighs 185 lb on Earth weigh on the Moon? Round your answer to the nearest tenth.

Answers

A man who weighs 185 lb on Earth weighs 30.8 lb on the Moon

Two variables are said to be directly proportional if as one variable increases/decreases, the other variables does the same by the same amount.

Let y represent the weight of object on earth and x represent the weight of object on the moon.

y ∝ x

y = kx

When y = 66, x = 10.92, hence:

66 = 10.92k

k = 6

When y = 185 lb:

185 = 6x

x = 30.8 lb

A man who weighs 185 lb on Earth weighs 30.8 lb on the Moon

Find out more at: https://brainly.com/question/25225528

Answer:

30.8lb

Step-by-step explanation:

How can you compare data sets?

Answers

Answer:

Grapgical charts and data plots

Step-by-step explanation:

Graphically.

Spread.

Shape.

Unusual features.

Step-by-step explanation:

Hope it helps you!!

need help with this algebra ii question

Answers

Vertex form: y = |x - h| + k

Vertex = (h, k)

G(x) was shifted 3 to the right and up 2.

G(x) = |x - 3| + 2

Hope this helps!! :)

Other Questions
Cholera bacteria causes sever diarrhoea. These bacteria spread rapidly when sewage is not piped away. Why is this? please help with this algebra ii question What happens when the two atoms are fairly close? Discuss the following question. Would you recommend living in a city or living in the desert?Include information about: the similarities and differences the reasons one place is better than the other 2,631 dividido entre 24 Read that From picture and tell me the answer please How are taking photographs and making casts similar? How are they different? An algorithmic solution to a problem is one in which a. a learned set of rules is used in answering the problem. b. the answer is arrived at by using the availability heuristic. c. the answer is arrived at by intuition. d. general and functional techniques are used in answering the problem. what is wind? 5ponts Use the map to determine the absolute and relative locations of physical features in Egypt:The relative location of Cairo is .The absolute location of Thebes is .The Sinai Peninsula is located of the rest of Egypt. It also lies of the Red Sea. Solve: 6x + 9 - x = 3x + 9 + xA) One solutionB) Infinite solutionC) No solution What force is represented by the vector?O frictionO gravityO normal forceO pushSomeone pls help Which of the following scenarios does NOT involve feelings leading to conflict? A. Sally ignores Betty's opinion. B. Sally feels Betty is wrong. C. Sally shares Betty's concerns. D. Sally tells Betty what to think. Please select the best answer from the choices provided. A B C D you and your friend went shopping. you bought 3 shirts and 4 sweaters for $69. your friend bought 6 shirts and 2 sweaters for $66 how much does one shirt and one sweater coat eachI need this answered quickly because one original strand of the double-stranded helix is found in each daughter molecule, the replication process is called If you were able to magnify a penny down to the atomic level, what twoobservations could you make about the atoms? The graph below represents the motion of a car.What is the average speed of the car? What is ethnocentrism and discuss why people are ethnocentric How do cells in an embryo become different types of cells? How did the Fertile Crescent interact with the rest of the world?andcure andvation ofPeople from other regions of the world rejected the ideas comingfrom the Fertile CrescentBl-bearingcording toandTrade with other regions allowed the ideas and inventions from theFertile Crescent to spread all over the world,Sargon the Great conquered and ruled over most of the world.dogas wellurther-st beer inivers (theDFamous stories from the rest of the world such as the Atrahasis andNoah's flood were popular in the Fertile Crescent