Explain why diversity is important for the survival of a species?

Answers

Answer 1

Answer:

The importance of genetic diversity. More specifically, genetic diversity can be a species natural defence system against disease and survival even under extreme weather conditions but more importantly, genetic diversity can help weed out unfavourable traits in species which maximises opportunities for thriving in any environment². hoped it helped.

Explanation:

Answer 2

Increased genetic diversity leads to increased chance of species survival. Species with a limited variety of phenotypes and where all members of the species are similar to one another have a smaller chance of coping with environmental variability compared to a species with greater diversity.

PLEASE MARK ME AS BRAINLIEST


Related Questions

Describe the structure and function starch

Answers

Answer:

Starch is a carbohydrate. Carbs supply quick energy. Starches are a polysaccharide which are complex carbs. Its monomer is a monosaccharide

Explanation:

Starch: structure Starch is the storage polysaccharide of plants It is stored as granules in plastids (e.g. chloroplasts) and amyloplasts (small, membrane-bound organelles containing starch granules) Due to starch molecules being large polymers consisting of thousands of glucose monomers, starch takes longer to digest than glucose

Which of the following correctly describes the outcome of meiosis?

Answers

Answer:The cell produced at the end of meiosis contained half of the number of chromosomes as the parent cell

Explanation:hope this helps and happy hallowen :D

Answer:

A. Four haploid daughter cells that are genetically different.

Explanation:

The cell produces energy in the


Please help

Answers

Answer:

Mitochondria

Explanation:

Answer:

In the mitochondria where atp is produced

Explanation:

all livings things are?​

Answers

Matter we are all matter and living things

Which option illustrates where the youngest crust is formed?

Question 2 options:

A


B


C


None of them

Answers

The mid-oceanic ridges is a place located in the Atlantic ocean is know for the concept of seafloor spreading. New seafloor is being created on another side of the ridge.

The diagram or illustration represents the mid-Atlantic ridge which is the zone of upwelling of magma.  As the magma upwells it gets deposited on both sides. According to paleomagnetism the magma on both left and right sides leads to the creation of plate tectonics. Hence more close they form the more recent or younger rocks/plates as compared to those formed farther away near the continental mass.  

Thus the correct option is A.

Learn more about the illustrates where the youngest crust is formed.

brainly.com/question/1807609.

How environmental conditions influence modern history?
Plz it’s 7th grade science

Answers

Answer:

it helps future generations understand the impacts of humans and pollution on health.

Explanation:

How does water rise from the roots of a tree to the very top?

Answers

Answer:

Explanation:

" Water travels from a tree's roots to its canopy by way of this conductive tissue. In hardwoods, water moves throughout the tree in xylem cells called vessels, which are lined up end-to-end and have large openings in their ends. In contrast, the xylem of conifers consists of enclosed cells called tracheids."

For which of the following reasons do small, isolated islands have a greater rate of
species extinction than larger, less isolated islands?

Answers

Answer:

Larger islands that are large and close to the mainland are shos lower rate of extinction due to the fact that the species present have more space so there will be more resources available in comparison to smaller islands where limited space and limited resources available.

Extinction is greater on islands isolated due to the unlikelihood of immigration and as it is opposite to the island close to the mainland and competition is more in isolated islands.

Lack of immigration, lower space and resources are the reasons small isolated islands have a greater rate of  extinction.

Large islands have large space for the growth of an organism as well as more resources which lowers the competition between organisms while on the other hand, small islands have lower space for growth and low amount of resources which causes to more competition leads to greater rate of extinction so we can conclude that lack of immigration, lower space and resources are the factors that affect the rate of extinction.

Learn more: https://brainly.com/question/18247827

what of the following are functions of lipids? choose three correct answers

Answers

You didn't give any of the options so i'm gonna assume

forming waxy leaf coverings

storing energy in fat cells

forming cell membranes

Which of the following are needed by all living things? water, oxygen, food water, nutrients, energy source rain, nutrients, sunlight water, oxygen, energy source

Answers

Answer:

A.

Explanation:

Answer:

A

Explanation:

Which of the following correctly matches an organelle and its functions?
Lysosome .... movement
O
Mitochindria..... photosynthesis
Central vacuole .... storage
Nucleus .... cellular respiration
O
Ribosomes ..... manufacturer of lipids

Answers

central vacuole is storage

proteins that act as catalysts in biological reactions

A. glucose
B. enzyme
C. ATP
D. molecule
PLS ANSWER ITS URGENT

Answers

C is the correct answer

What is NOT an example of a primary consumer?
co
A deer that eats mostly grass
b An osprey that eats mostly fish
C
A mouse that eats mostly seeds
d A squirrel that eats mostly acorns

Answers

Answer:

b An osprey that eats mostly fish

Explanation:

or a primary consumer is an animal that feeds on plants; a herbivore.

the single main root is called the...

Answers

Answer:The first root that germinates from the seed is called‘radical’ The radical develops into single prominent root called as ‘primary or main root’ It is the strongest and grows vertically downwards due to gravitation and deep into the soil Several branches arise from the main tap root known as lateral or secondary roots

Explanation:

Answer:

the taproot

Explanation:

Which of the following is NOT a form of active transport?
A) cyclosis
B) phagocytosis
C) diffusion
D) pinocytosis

Answers

Answer:

B) phagocytosis.

Explanation:

Phagocytosis is a process in which a cell attaches to the element it wishes to enclose on the exterior of the cell and attracts the item within as it encloses it. Phagocytosis is commonly done when the cell, such as a virus or an infected cell, is attempted to destroy things and often is employed by immune cells.

This is quite particular and dependent on the cell being able to bind to an article it wishes to ingest via cell surface receivers.

Phagocytoses differs from other techniques of endocytism. Unless the cell comes in direct contact with the particle it wishes to ingest, Phagocytosis will not occur.

Diffusion is a type of passive transport. It occurs when molecules transfer passively from high concentration to low concentration zones. So, option c is right.

Active transport involves using energy to move molecules across a membrane against a concentration gradient.

Pinocytosis and phagocytosis are both types of endocytosis. Cytosis is the movement of cytoplasm within a cell. Both are examples of active transport since they both require energy.

Diffusion is the passive movement of molecules from a region of high concentration to a region of low concentration across a cell membrane. It's an example of passive transport not active transport.

Therefore, Diffusion is the only option that is not an active transport mechanism. Thus, option C is correct.

Learn more about active transport here;

https://brainly.com/question/29759743

#SPJ6

What are the two inputs for aerobic cellular respiration?

a. oxygen and glucose
b. carbon dioxide and atp
c. carbon dioxide and water
d. glucose, atp and water

Answers

A is your answer and Hey

Oxygen and glucose are the two inputs for aerobic respiration.

What are Cellular respiration?

The process of cellular respiration involves the oxidation of biological fuels in the presence of an inorganic electron acceptor, like as oxygen, to generate significant amounts of energy that are used to power the major creation of ATP.

The process of converting chemical energy from foods into adenosine triphosphate (ATP) in an organism's cells, followed by the discharge of waste products, is known as cellular respiration. 

During catabolic reactions, which divide big molecules into smaller ones and release energy, respiration takes place. One of the main mechanisms through which a cell releases chemical energy to power cellular activity is respiration.

Therefore, Oxygen and glucose are the two inputs for aerobic respiration.

To learn more about Cellular respiration, refer to the link:

https://brainly.com/question/29760658

#SPJ2

1. What is the difference between MODERN classification hierarchy and Linnaen
classification hierarchy?

Answers

heyyyy so the answer is the person above me

What two important properties do all lipids share?

Answers

Answer:

all lipids repel water. all lipids are made primarily of carbon and hydrogen

Explanation:

i hope this helps:)

What are nucleic acids responsible for?

Answers

Answer:

The functions of nucleic acids have to do with the storage and expression of genetic information. Deoxyribonucleic acid (DNA) encodes the information the cell needs to make proteins. A related type of nucleic acid, called ribonucleic acid (RNA), comes in different molecular forms that participate in protein synthesis.

Explanation:

Nucleotides are important as they form the building blocks of nucleic acids, such as DNA and RNA. Nucleotides are made up of 3 parts. The first is a distinct nitrogenous base, which is adenine, cytosine, guanine or thymine.

Which molecule is formed when the protein ferrodoxin transfers electrons to an electron carrier?

Answers

Answer:

NADPH, it from the energy storage molecule

Hope this helps

Answer: NADPH

Explanation:

woof

what is four the terrestrial planets​

Answers

Mercury, Venus, Earth and Mars

Answer:

Explanation:

Terresterial comes from the greek work "terra", which means Earth. So when you hear the word "terresterial " think that it means "like Earth". More specifically, it means that a planet is SOLID, like the Earth is. So, to figure out the answer to your question, let's list the planets starting with the ones closest to the sun and work out way out toward deep space. We can also describe each planet a bit as we list them.

Mercury - Closest to the Sun and, because of that, its very hot here. A lot of the ground on this planet is lava made of molten metal which is a liquid BUT there is also solid ground so it is terresterial. ✓

Venus - 2nd closest to the Sun. There is ground here, so it's terresterial. ✓

Earth - 3rd closest to the sun. There is solid ground here too so... Terresterial ✓

Mars - Also Solid. Terresterial ✓

Jupiter - Jupiter is made of Gas. If you went there, there would be nothing solid to walk on, but instead simply pass through it like it was a cloud. Therefore it is NOT terresterial

Saturn - Also a "Gas Giant" plant. (They are called gas giants because these planets are huge! You could fit 764 planet Earths inside of Saturn and over 1300 Earths could fit inside Jupiter!) Gas = NOT terresterial

Uranus - Another Gas Giant. Not terresterial

Neptune - The last of the gas giant planets and the furthest from the Sun. Again, its made of gas so its... not terresterial!

If you have trouble remembering the order, try memorizing this:

   "My   -   Very  -  Epic - Mother - Just  -  Served  -   Us   -   Nachos"

Mercury - Venus - Earth - Mars - Jupiter - Saturn - Uranus - Neptune

Let me know if you need any more help! I am a scientist at NASA and my research focuses on all the planets you're currently learning about! Im happy to help out where I can.

Why should you never smell a chemical directly?
A. Many chemicals have no smell.
O B. All chemicals smell the same.
C. You cannot learn anything by smelling.
D. Some chemicals can hurt your windpipe.

Answers

Answer:

D

Explanation:

Some chemicals can hurt your windpipe

Answer:

D

Explanation:

by directly smelling something you are ingesting tiny particles of it, which is why directly smelling a chemical is a bad idea.

48:47
Which of the following factors would have the smallest impact on a population’s size?
a.
the total number of organisms
b.
the available water supply
c.
the variety of organisms
d.
adequate shelter

Answers

I think the answer is c

EMERGENCY! PLEASE ANSWER ASAP! ​

Answers

Answer:

they suck up liquid

Explanation:

they drink the other bugs blood (cool huh)

Which of the following would be a function of the nucleic acids?

A.
They are used to store and transmit genetic information

B.
They are used to store energy

C.
They are used for structural purposes

D.
They are used to insulate the body

Answers

A. There are used to store and transmit genetic information

Nucleic acids include DNA and RNA, are the genetic material in living things. The main function of the nucleic acids is to store and transmit the genetic information. Thus, the correct option is A.

What are Nucleic acids?

Nucleic acids are biopolymers, which are essential to all known forms of life. They are composed of nucleotide polymers. Nucleotides are the monomers of nucleic acids which are made up of three components: a 5-carbon sugar, a phosphate group and a nitrogenous base. The two main classes of nucleic acids are deoxyribonucleic acid (DNA) and ribonucleic acid (RNA).

Nucleic acids play essential roles in all cells and viruses. The main function of nucleic acids involves storage and expression of genetic information in organisms. Deoxyribonucleic acid (DNA), encodes the information cells need to make proteins.

Therefore, the correct option is A.

Learn more about Nucleic acids here:

https://brainly.com/question/11309892

#SPJ2

The lumper potatoes that were grown in Ireland during the 1800s were essentially clones of one another. They all had the same genetic makeup. So, when a potato blight disease began infecting the potatoes, it spread to all potatoes equally. How could greater genetic diversity have lessened the devastation of the potato blight?

Answers

The question has options that are given as below:

A. Some potatoes would be more likely to have a genetic resistance to the disease and survive. B. The potatoes would have been able to trade genes so that they could survive the disease. C. More of the potatoes would have been edible varieties. D. None of the potatoes would have been infected by the disease.

Answer:

The correct answer is - A. Some potatoes would be more likely to have a genetic resistance to the disease and survive.

Explanation:

Genetic resistance is the capability or ability of some individual organisms of a population or species have to adapt the environmental or genetic changes and survive while other organisms of species are not able to do the same.

In this case, some of the potatoes more likely to show genetic resistance to the disease and condition and survive from the devastation of the potato blight

How does population density differ from population size?
a.
Population size takes all organisms into account, while population density only takes specific age groups of the population into account.
b.
Population size is the total number of organisms, while population density is the total number of organisms within a given area.
c.
Population size is the total number of organisms within a given area, while population density is the total number of organisms of a specific age.
d.
Population size is the total number of organisms of all species, while population density is the total number of organisms of a specific species.

How does population density differ from population size?
a.
Population size takes all organisms into account, while population density only takes specific age groups of the population into account.
b.
Population size is the total number of organisms, while population density is the total number of organisms within a given area.
c.
Population size is the total number of organisms within a given area, while population density is the total number of organisms of a specific age.
d.
Population size is the total number of organisms of all species, while population density is the total number of organisms of a specific species.

Answers

Population size is the number of individuals in a population. Population density is the average number of individuals per unit of area or volume.

Answer:

b

Explanation:

please help me out here

Answers

I’d say A but don’t trust my answer lol I’m dumb

As ecosystems move through the states of succession, the populations of organisms in them change. Which of the following describes the stage of succession likely to have the most species diversity?

Answers

A temperate forest that has never been cleared by logging
Explanation:
Biodiversity involves having different species of plants and animals present in a given area or space.



A bacterium, containing one circular DNA chromosome, undergoes four rounds of replication. How many new strands of DNA would result?

Answers

Answer:

The correct answer is 32 strands.

Explanation:

In bacterium, DNA replication is bidirectional which means it takes place in both directions. The origin of replication starts the replication, it is a specific sequence of nucleotides. Each strand of circular DNA acts as a parent strand to replicate its complementary new strand, resulting in two new DNA strands, one parent strand, and one new synthesized strand. So after the first round of replication, there are 4 strands formed.

Similarly, during the second round of replication each of the four strands will be synthesized lead to a total of 8 strands in the same manner. So by the same process in 3rd round will lead to 16 new strands and by the fourth round of replication 32 strands will be synthesized.

Thus, the correct answer is 32 strands.

Other Questions
Based on sentence fluency, transitions, and writing conventions, which conclusion most needs revision?Finally, scientists continue to argue their cases for and against a manned mission to Mars. However, an eventual mission seems likely.In the end, there are logical pros and cons for a manned mission to Mars. It seems its more a matter of when it will happen than if it happens.In conclusion, there are good arguments for and against a manned mission to Mars. But based on the evidence, it seems as though a manned mission is likely.Overall, scientists continue to debate the pros and cons of a manned mission to Mars. Yet despite their indecision, it seems almost certain that a mission will happen. Which is the electron configuration for zinc? You are asked to devise a procedure for quality control in a fertilizer plant to check that the nitrogen and phosphorus content is within a specified range. You decide on the outlined steps to monitor a production run of 1000 bags of fertilizer. A. A 50 g sample is removed from every 100th bag of fertilizer produced, resulting in ten 50 g samples. B. Samples 1, 3, 5, 7, and 9 are thoroughly mixed and a 50 g sample of the mixture is removed. C. Samples 2, 4, 6, 8 and 10 and the 50 g sample from the mixture are taken to the analytical laboratory. D. Each 50 g sample is separately dissolved in a fixed volume of water and the solution is filtered to determine the quantity of insoluble material. E. Separate aliquots of the water solutions are subjected to the procedures of phosphorus and nitrogen analysis. The author writes, "In my private life, I've lost contact with family members and I've seenfriendships die in silence when I failed to say what was really on my mind. What is thenauthor's purpose for including this reflection? (For the story How to have conversations that matter) HELP Still i need help i will give brainliest The endpoints of AB are A(7, 6) and B(5, 6). What are the coordinates of point C on AB that is 1/3 the distance from point A to point B? To which family does the function y = (x + 2) Superscript one-half Baseline + 3 belong?quadraticsquare rootexponentialreciprocal Which of the following is NOT a reason that people moved to the cities? aThe city was an easier place to live because sanitation and jobs were not dangerous to ones health. bMany of the new immigrants had to settle in the cities because they didnt have the money to move west. cThe machines that did most of the farm work meant that labor was no longer needed on the farm, so most of the farm workers moved into the cities. dPeople who couldnt find work in their area, like African-Americans in the South, moved into cities to get jobs. describe a pentagonal prism. Solve *(6 + 3y2 + (9-10 + 5) xyctccccccccccccccccccccccccc Simplify the expression(-n+8)+(-n+5) Which of the following equations is nonlinear?y = 3y = 8x - 1y = 5xy = 5x3 Which expression is equivalent to cos(103)cos(54) sin(103)sin(54)?sin(49)cos(49)sin(157)cos(157) 1.Is this a direct quote or an indirect quote? I said, No, you can't go to the mall!a. Directb. Indirect it takes 70 inches of ribbon around a box. the bow takes 32 inches of ribbon the width of the box is 14 inches. what is the height of the box No me ____________________ (gustar) leer. Me ____________________ (aburrir) los libros. Please answer the following questions. Nineteen times she went back SouthTo get three hundred othersShe ran for her freedom nineteen timesTo save Black sisters and brothersHarriet Tubman,Eloise GreenfieldWhat does this text reveal about Tubman? Why did taxes increaseA. In the last year of his rule kublai khan ran into trouble.B. The chinese resented the heavy burden these taxes place on themC. They fought over control of the empire.D. All of the above