sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Answer 1
Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

Related Questions

A record store owner finds that 20% of customers entering her store make a purchase. One morning 180 people, who can be regarded as a random sample of all customers, enter the store.
a. What is the mean of the distribution of the sample proportion of customers making a purchase?
b) What is the variance of the sample proportion?
c) What is the standard error of the sample proportion?
d) What is the probability that the sample proportion is less than 0.15?

Answers

Answer:

a) 0.2

b) 0.0009

c) 0.0298

d) 0.0465 = 4.65% probability that the sample proportion is less than 0.15.

Step-by-step explanation:

To solve this question, we need to understand the normal probability distribution and the central limit theorem.

Normal Probability Distribution

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Central Limit Theorem

The Central Limit Theorem establishes that, for a normally distributed random variable X, with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the sampling distribution of the sample means with size n can be approximated to a normal distribution with mean [tex]\mu[/tex] and standard deviation [tex]s = \frac{\sigma}{\sqrt{n}}[/tex].

For a skewed variable, the Central Limit Theorem can also be applied, as long as n is at least 30.

For a proportion p in a sample of size n, the sampling distribution of the sample proportion will be approximately normal with mean [tex]\mu = p[/tex] and standard deviation [tex]s = \sqrt{\frac{p(1-p)}{n}}[/tex]

20% of customers entering her store make a purchase.

This means that [tex]p = 0.2[/tex]

180 people

This means that [tex]n = 180[/tex]

a. What is the mean of the distribution of the sample proportion of customers making a purchase?

By the Central Limit Theorem, [tex]\mu = p = 0.2[/tex].

b) What is the variance of the sample proportion?

The standard deviation is:

[tex]s = \sqrt{\frac{0.2*0.8}{180}} = 0.0298[/tex]

Variance is the square of the standard deviation, so:

[tex]s^2 = (0.0298)^2 = 0.0009[/tex]

c) What is the standard error of the sample proportion?

As found in the previous item, 0.0298.

d) What is the probability that the sample proportion is less than 0.15?

This is the p-value of Z when X = 0.15. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

By the Central Limit Theorem

[tex]Z = \frac{X - \mu}{s}[/tex]

[tex]Z = \frac{0.15 - 0.20}{0.0298}[/tex]

[tex]Z = -1.68[/tex]

[tex]Z = -1.68[/tex] has a p-value of 0.0465.

0.0465 = 4.65% probability that the sample proportion is less than 0.15.

[tex]\sqrt{25}[/tex]=?

Answers

[tex]Hello[/tex] [tex]There[/tex]

The answer is...

[tex]5.[/tex]

[tex]HopeThisHelps!![/tex]

[tex]AnimeVines[/tex]

Hi the answer is 5 to this problem
Hope it helps.

Please answer and explain :)
Write an example for each of the following:
equation notation
set notation
interval notation
solution graph

Answers

Answer:

set notation _ A set is denoted or represented by a capital letter and enclosed in a curly bracket For example {A,B,P,Q}.

Sketch the region of integration and convert the polar integral to a Cartesian integral or sum of integrals. Do not evaluate the integral.
∫ ^π∫^2 r^3 sinθcosθdrd()
π/2 0

Answers

It looks like the integral in polar coordinates is given to be

[tex]\displaystyle\int_{\pi/2}^\pi \int_0^2 r^3\sin(\theta)\cos(\theta)\,\mathrm dr\,\mathrm d\theta[/tex]

Converting back to Cartesian, we take

x = r cos(θ)

y = r sin(θ)

dx dy = r dr dθ

so we can easily recover the integrand in Cartesian:

[tex]r^3\sin(\theta)\cos(\theta)\,\mathrm dr\,\mathrm d\theta = (r\sin(\theta))(r\cos(\theta))(r\,\mathrm dr\,\mathrm d\theta) = xy\,\mathrm dx\,\mathrm dy[/tex]

This leaves us with the limits:

• π/2 ≤ θ ≤ π corresponds to the second quadrant of the (x, y)-plane (that is, where x < 0 and y > 0)

• 0 ≤ r ≤ 2 correspond to the disk of radius 2 centered at the origin

Taken together, we see the region of integration is a quarter-disk of radius 2 in the second quadrant, which we can capture by the set

{(x, y) : -√2 ≤ x ≤ 0 and 0 ≤ y ≤ √(2 - x ²)}

So, in Cartesian coordinates, the integral would be

[tex]\displaystyle \boxed{\int_{-\sqrt2}^0 \int_0^{\sqrt{2-x^2}} xy\,\mathrm dy\,\mathrm dx}[/tex]

Which of the following expressions is equal to tan205°?
tan55°
tan25°
tan25°

Answers

Answer:

the write answer to your question is tan 25 degree

Mary takes out a loan for $6,000 at a simple interest rate of 12% to be paid back in 36 monthly instalments. What is the amount of her monthly payments?

Answers

Answer:

$199.29

Step-by-step explanation:

Total payments = $7,174.24

Total interest = $1,174.24

Suppose that there are two internet service providers in Kabwe, Eyeconnect and Topconnect.
Currently, Eyeconnect has 180 000 customers and Topconnect has 120 000 customers.
Assume that, every year, 10% of the customer base of Eyeconnect switches to Topconnect
and 5% of the customer base of Topconnect switches to Eyeconnect. For the purposes of this
question, suppose no customer leaves a company without switching to the other one and no
company attracts customers that are not leaving the other (that is, the only changes in
customer base come from switching between the two companies).
a. Find the number of customers of Eyeconnect and Topconnect after one year.
b. Find the number of customers of Eyeconnect after many years.

Answers

Answer:

a. 168000 for Eyeconnect, 132000 for Topconnect

b. 100,000

Step-by-step explanation:

a.

Because the change in customers are only due to leaving companies, we can say that, after one year, Eyeconnect loses 10% of its customers to Topconnect and Topconnect loses 5% of its customers to Eyeconnect. This represents all changes in customers.

First, we can calculate how much Eyeconnect loses, which is 10% of 180,000 = 0.1 * 180,000 = 18,000 . They then have 180,000 - 18,000 = 162,000 employees

Next, Topconnect loses 120,000 * 5% = 120,000 * 0.05 = 6,000. They then have 120,000-6,000 = 114,000 employees

We can then add the customer amounts. Note that we are subtracting both sides before adding as both companies gain and lose customers simultaneously.

We can then add how much one company lost to the other company's customers.

Eyeconnect gains 6,000 customers, so they then have 162,000 + 6,000 = 168000 employees. Topconnect gains 18,000 customers so they then have 114,000 + 18,000 = 132,000 employees

b.

After many years, the number of customers Eyeconnect has will be less than the number of customers that Topconnect has. One way to find the end amount of customers that Eyeconnect has is to figure out when the customer bases even out, or when Eyeconnect loses the same amount of customers as Topconnect so the customer base stays the exact same. We know that no customers leave or join the companies except to leave/join the other, so the total amount of customers between the two companies stays the exact same. The amount of customers is 180,000 + 120,000 = 300,000. Therefore, at the end amount,

Eyeconnect customers (E) + Topconnect customers (T) =300,000

Furthermore, if the amount of customers that leave Eyeconnect is the same that leaves Topconnect, we can say

E * 0.1 = T * 0.05

divide both sides by 0.05 to isolate the T

E * 0.1 / 0.05 = T

2 * E = T

plug that into the first equation

E + 2 * E = 300,000

3 * E = 300,000

divide both sides by 3 to isolate E

E = 100,000 after many years

The Laplace Transform of a function f(t), which is defined for all t > 0, is denoted by L{f(t)} and is defined by the improper integral L{f(t)}(s) = infinity 0 e-st.f(t)dt, as long as it converges. Laplace Transform is very useful in physics and engineering for solving certain linear ordinary differential equations. (Hint: think of as a fixed constant)
1. Find L{t}. (hint: remember integration by parts)
A. 1
B. -1/s2
C. 0
D. 1/s2
E. -s2
F. None of these
2. Find L{1}.
a.1/s
b. 1
c. 0
d. -s
e. -1/s
f. none of these

Answers

(1) D

[tex]L_s\left\{t\right\} = \displaystyle\int_0^\infty te^{-st}\,\mathrm dt[/tex]

Integrate by parts, taking

[tex]u = t \implies \mathrm du=\mathrm dt[/tex]

[tex]\mathrm dv = e^{-st}\,\mathrm dt \implies v=-\dfrac1se^{-st}[/tex]

Then

[tex]L_s\left\{t\right\} = \displaystyle \left[-\frac1ste^{-st}\right]\bigg|_{t=0}^{t\to\infty}+\frac1s\int_0^\infty e^{-st}\,\mathrm dt[/tex]

[tex]L_s\left\{t\right\} = \displaystyle \frac1s\int_0^\infty e^{-st}\,\mathrm dt[/tex]

[tex]L_s\left\{t\right\} = \displaystyle -\frac1{s^2}e^{-st}\bigg|_{t=0}^{t\to\infty}[/tex]

[tex]L_s\left\{t\right\} = \displaystyle \boxed{\frac1{s^2}}[/tex]

(2) A

[tex]L_s\left\{1\right\} = \displaystyle\int_0^\infty e^{-st}\,\mathrm dt[/tex]

[tex]L_s\left\{1\right\} = \displaystyle\left[-\frac1se^{-st}\right]\bigg|_{t=0}^{t\to\infty}[/tex]

[tex]L_s\left\{1\right\} = \displaystyle\boxed{\frac1s}[/tex]

which ecpression is the simplest form of 3(3x-4)-5(x+3)

Answers

[tex]\boxed{ \sf{Answer}} [/tex]

[tex] \sf \: 3(3x - 4) - 5(x + 3) \\ \sf =( 3 \times 3x) - (3 \times 4) + ( - 5 \times x) +( - 5 \times 3 ) \\ \sf = 9x - 12 - 5x - 15 \\ \sf = 9x - 5x - 12 - 15 \\ = \underline{ \bf 4x - 27}[/tex]

ʰᵒᵖᵉ ⁱᵗ ʰᵉˡᵖˢ

꧁❣ ʀᴀɪɴʙᴏᴡˢᵃˡᵗ2²2² ࿐

[tex]\\ \sf\longmapsto 3(3x-4)-5(x+3)[/tex]

[tex]\\ \sf\longmapsto 9x-12-5x-15[/tex]

[tex]\\ \sf\longmapsto 9x-5x-15-12[/tex]

[tex]\\ \sf\longmapsto (9-5)x-27[/tex]

[tex]\\ \sf\longmapsto 4x-27[/tex]

If you have a volume of 366,514 cm, how many ft does that make? Round to 1 decimal.​

Answers

Answer:

12024.7

Step-by-step explanation:

Searched it up.

then rounded

What is the solution of log3x + 4 4096 = 4?

Answers

Step-by-step explanation:

X= - 1

X=0

X=4/3

X=3

We solve for x by simplifying both sides of the equation, then isolate the variable.

Answer :

C (x=4/3)

Find x.

A. 7√6/2
B. 28
C. 21/2
D. 7√6

Answers

9514 1404 393

Answer:

  A. 7√6/2

Step-by-step explanation:

The side ratios of the 30-60-90 triangle are 1 : √3 : 2. This means the horizontal line segment is 7√3.

The side ratios of the 45-45-90 triangle are 1 : 1 : √2. This means ...

  x = (horizontal segment)/√2 = (√2)/2 × 7√3 = (7/2)√(2·3)

  x = 7√6/2

In 2018, Mike Krzyewski and John Calipari topped the list of highest paid college basketball coaches (Sports Illustrated website). The following sample shows the head basketball coach's salary for a sample of 10 schools playing NCAA Division I basketball. Salary data are in millions of dollars.
University Coach's Salary University Coach's Salary
North Carolina State 2.2 Miami (FL) 1.5
Iona 0.5 Creighton 1.3
Texas A&M 2.4 Texas Tech 1.5
Oregon 2.7 South Dakota State 0.3
Iowa State 2.0 New Mexico State 0.3
a. Use the sample mean for the 10 schools to estimate the population mean annual salary for head basketball coaches at colleges and universities playing NCAA Division I basketball.
b. Use the data to estimate the population standard deviation for the annual salary for head basketball coaches.
c. What is the 95% confidence interval for the population variance?
d. What is the 95% confidence interval for the population standard deviation?

Answers

From the data given, we estimate the population mean and population standard deviation. Then, we use this estimate to find a 95% confidence interval for the population variance and the population standard deviation.

Sample:

Salaries in millions of dollars: 2.2, 1.5, 0.5, 1.3, 2.4, 1.5, 2.7, 0.3, 2.0, 0.3

Question a:

The mean is the sum of all values divided by the number of values. So

[tex]\overline{x} = \frac{2.2 + 1.5 + 0.5 + 1.3 + 2.4 + 1.5 + 2.7 + 0.3 + 2.0 + 0.3}{10} = 1.42[/tex]

The sample mean salary is of 1.42 million.

Question b:

The standard deviation is the square root of the difference squared between each value and the mean, divided by one less than the number of values.

So

[tex]s = \sqrt{\frac{(2.2-1.42)^2 + (1.5-1.42)^2 + (0.5-1.42)^2 + (1.3-1.42)^2 + (2.4-1.42)^2 + (1.5-1.42)^2 + (2.7-1.42)^2 + ...}{9}} = 0.8772[/tex]

Thus, the estimate for the population standard deviation is of 0.8772 million.

Question c:

The sample size is [tex]n = 10[/tex]

The significance level is [tex]\alpha = 1 - 0.05 = 0.95[/tex]

The estimate, which is the sample standard deviation, is of [tex]s = 0.8772[/tex].

Now, we have to find the critical values for the Pearson distribution. They are:

[tex]\chi^2_{\frac{\alpha}{2},n-1} = \chi^2_{0.025,9} = 19.0228[/tex]

[tex]\chi^2_{1-\frac{\alpha}{2},n-1} = \chi^2_{0.975,9} = 2.7004[/tex]

The confidence interval for the population variance is:

[tex]\frac{(n-1)s^2}{\chi^2_{\frac{\alpha}{2},n-1}} < \sigma^2 < \frac{(n-1)s^2}{\chi^2_{1-\frac{\alpha}{2},n-1}}[/tex]

[tex]\frac{9*0.8772^2}{19.0228} < \sigma^2 < \frac{9*0.8772^2}{2.7004}[/tex]

[tex]0.3641 < \sigma^2 < 2.5646[/tex]

Thus, the 95% confidence interval for the population variance is (0.3641, 2.5646)

Question d:

Standard deviation is the square root of variance, so:

[tex]\sqrt{0.3641} = 0.6034[/tex]

[tex]\sqrt{2.5646} = 1.6014[/tex]

The 95% confidence interval for the population standard deviation is (0.6034, 1.6014).

For more on confidence intervals for population mean/standard deviation, you can check https://brainly.com/question/13807706

Can I get some help
Please!!

Answers

Answer:

option D is the answer

Step-by-step explanation:

using the HH,ll,ha and la,

where h is the hypotenuse and l is the leg

A family has a day of 7 activities planned: shopping, picnic, hiking, swimming, bike ride, video games, and movie. To make it more adventurous they decide to randomly pick the order of the activities out of a hat. Find the probability that bike ride and movie are chosen consecutively, in either order.

Answers

Answer:

[tex]Pr= \frac{1}{21}[/tex]

Step-by-step explanation:

Given

[tex]n(S) = 7[/tex] --- number of games

Required

Probability of bike and movie in consecutive order

This probability is represented as:

[tex]Pr = P(Bike\ and\ Movie) \ or\ P(Movie\ or\ Bike)[/tex]

So, we have:

[tex]Pr = P(Bike\ and\ Movie) \ +\ P(Movie\ or\ Bike)[/tex]

The probability is an illustration of selection without replacement;

So, we have:

[tex]P(Bike\ and\ Movie) = P(Bike) * P(Movie)[/tex]

[tex]P(Bike\ and\ Movie) = \frac{n(Bike)}{n(S)} * \frac{n(Movie)}{n(S) - 1}[/tex] ---- without replacement

Bike and Movie appear in the game list 1 time.

So, the equation becomes

[tex]P(Bike\ and\ Movie) = \frac{1}{7} * \frac{1}{7 - 1}[/tex]

[tex]P(Bike\ and\ Movie) = \frac{1}{7} * \frac{1}{6}[/tex]

[tex]P(Bike\ and\ Movie) = \frac{1}{42}[/tex]

Similarly,

[tex]P(Movie\ and\ Bike) = \frac{1}{42}[/tex]

So, we have:

[tex]Pr = P(Bike\ and\ Movie) \ +\ P(Movie\ or\ Bike)[/tex]

[tex]Pr= \frac{1}{42}+\frac{1}{42}[/tex]

Take LCM

[tex]Pr= \frac{1+1}{42}[/tex]

[tex]Pr= \frac{2}{42}[/tex]

[tex]Pr= \frac{1}{21}[/tex]

I need help guys thanks so much

Answers

Answer:

2

Step-by-step explanation:

8 ^ (5/3) ^ 1/5

We know a^b^c = a^(b*c)

8^ (5/3*1/5)

8^ 1/3

Rewriting 8 as 2^3

2^3 ^1/3

2 ^(3*1/3)

2^1

2

Answer:

2

Step-by-step explanation:

((2^3)^5/3)^1/5

= (2^5)^1/5

= 2

Answered by Gauthmath

write the greatest and smallest four digit number by using 7,8,0,9 digit​

Answers

0789 is the smallest
9870 is the largest

Please help please !!!

Answers

Answer:  12

========================================================

Explanation:

You can use the AAS (angle angle side) theorem to prove that triangle ABD is congruent to triangle CBD.

From there, we can then say that AD and DC are the same length

AD = DC

3y+6 = 5y-18

3y-5y = -18-6

-2y = -24

y = (-24)/(-2)

y = 12

Please how do I solve this.

Answers

Answer:

Horizontal Shift: Right 1

Vertical Shift: Down 5

Reflection: None

Explanation: To find the transformation, compare the function to the parent function (being in this case g(x)=1/x) and check to see if there is a horizontal or vertical shift or a reflection.

So, the answer would be Right 1, and down 5

Hope this helps you out :)

right 1,down 5 is the answer

I need help on this 20 points

Answers

Answer:

4^15

Step-by-step explanation:

We know a^b^c = a^(b*c)

4^3^5

4^(3*5)

4^15



A plane traveled 4425 miles with the wind in 7.5 hours and 3675 miles against the wind in the same amount of time. Find the speed of the plane in still air and the speed of the wind

Answers

Answer:

540 miles/hr and 50 miles/hr respectively

Step-by-step explanation:

Let the speed of plane in still air be x and the speed of wind be y.

ATQ, (x+y)*7.5=4425 and (x-y)*7.5=3675. Solving it, we get x=540 and y=50

An urn contains 5 blue marbles and 4 yellow marbles. One marble is​ removed, its color​ noted, and not replaced. A second marble is removed and its color is noted.
(a) What is the probability that both marbles are blue? yellow​?
​(b) What is the probability that exactly one marble is blue​?

Answers

Answer:

(a)The probability that both marbles are blue=5/18

The probability that both marbles are yellow=1/6

(b)The probability that exactly one marble is blue​=5/9

Step-by-step explanation:

Blue marbles=5

Yellow marbles=4

Total marbles=5+4=9

(a)

Probability of drawing first  blue marble=5/9

Probability of drawing second blue marble without replacement=4/8

The probability that both marbles are blue

[tex]=\frac{5}{9}\times \frac{4}{8}=\frac{5}{18}[/tex]

Probability of drawing first  yellow marble=4/9

Probability of drawing second yellow marble without replacement=3/8

The probability that both marbles are yellow

[tex]=\frac{4}{9}\times \frac{3}{8}=\frac{1}{6}[/tex]

(b)

The probability that exactly one marble is blue​

=Probability of first blue marble (Probability of second yellow marble)+Probability of first yellow marble (Probability of second blue marble)

The probability that exactly one marble is blue​

=[tex]\frac{5}{9}\times \frac{4}{8}+\frac{4}{9}\times \frac{5}{8}[/tex]

=[tex]\frac{5}{18}+\frac{5}{18}[/tex]

=[tex]\frac{10}{18}=\frac{5}{9}[/tex]

For the following exercise, calculate the desired dose. Then calculate the amount to administer. Ordered: Pergolide mesylate 100 mcg PO tid On hand: Pergolide mesylate 0.05 mg tablets what is the Desired dose?​

Answers

Answer:

was assigned with this problem (the reference text is attached):

Which of the following, if included in a student's paper, would NOT be an example of plagiarism?

1. In the game of baseball, which is rather boring, the batter stands on home base (Hughes 1).

2. Baseball is rather surprisingly known as "America's Favorite Pastime."

3. Baseball is "a rather boring sport played between two teams of nine players" (Hughes 1).

4. All of these are plagiarism.

The answer tells that only the third choice is NOT a plagiarism. My question is, why is the first choice a plagiarismwas assigned with this problem (the reference text is attached):

Which of the following, if included in a student's paper, would NOT be an example of plagiarism?

1. In the game of baseball, which is rather boring, the batter stands on home base (Hughes 1).

2. Baseball is rather surprisingly known as "America's Favorite Pastime."

3. Baseball is "a rather boring sport played between two teams of nine players" (Hughes 1).

4. All of these are plagiarism.

The answer tells that only the third choice is NOT a plagiarism. My question is, why is the first choice a plagiarism

Step-by-step explanation:

was assigned with this problem (the reference text is attached):

Which of the following, if included in a student's paper, would NOT be an example of plagiarism?

1. In the game of baseball, which is rather boring, the batter stands on home base (Hughes 1).

2. Baseball is rather surprisingly known as "America's Favorite Pastime."

3. Baseball is "a rather boring sport played between two teams of nine players" (Hughes 1).

4. All of these are plagiarism.

The answer tells that only the third choice is NOT a plagiarism. My question is, why is the first choice a plagiarism

What is the solution to log (9x)-log, 3 - 3?
O X
col 00
8
X =
3
O x=3
OX=9

Answers

Answer:

x = 8/3

Step-by-step explanation:

Log₂(9x) – Log₂3 = 3

The value of x can be obtained as follow:

Log₂(9x) – Log₂3 = 3

Recall

Log M – Log N = Log (M/N)

Thus,

Log₂(9x) – Log₂3 = 3

Log₂(9x/3) = 3

Log₂3x = 3

3x = 2³

3x = 8

Divide both side by 3

x = 8/3

A particle moves along line segments from the origin to the points (3, 0, 0), (3, 4, 1), (0, 4, 1), and back to the origin under the influence of the force field F(x, y, z) = z^2i + 4xyj + 5y^2k. Use Stokes' Theorem to find the work done.

Answers

Answer:

the first option because I took the test

A group of 6 children and 6 adults are going to the zoo. Child tickets cost $10, and adult tickets cost $14. How much will the zoo tickets cost in all?

Answers

Answer:

i believe it'll cost 200 dollars

Answer: $144

This is because you have 6 children’s tickets each for $10, so you take the 6x10 which gives you $60. Then you have 6 adult tickets which cost $14, so you take 6x14 which equals $84. When added together that is $144!

Find the missing side round your answer to the nearest tenth

Answers

Answer:

x = 38.4

Step-by-step explanation:

tan(38) = 30/x

x = 30/tan(38)

x = 38.4

Answered by GAUTHMATH

What is the distance between the following points?
WILL GIVE BRAINLIEST!!

Answers

Answer:

A. 5

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Algebra I

Reading a coordinate planeCoordinates (x, y)

Algebra II

Distance Formula: [tex]\displaystyle d = \sqrt{(x_2 - x_1)^2 + (y_2 - y_1)^2}[/tex]

Step-by-step explanation:

Step 1: Define

Identify points from graph.

Point (8, 5)

Point (4, 2)

Step 2: Find distance d

Simply plug in the 2 coordinates into the distance formula to find distance d

Substitute in points [Distance Formula]:                                                         [tex]\displaystyle d = \sqrt{(8 - 4)^2 + (5 - 2)^2}[/tex][√Radical] (Parenthesis) Subtract:                                                                   [tex]\displaystyle d = \sqrt{4^2 + 3^2}[/tex][√Radical] Evaluate exponents:                                                                       [tex]\displaystyle d = \sqrt{16 + 9}[/tex][√Radical] Add:                                                                                                 [tex]\displaystyle d = \sqrt{25}[/tex][√Radical] Evaluate:                                                                                         [tex]\displaystyle d = 5[/tex]

Calculus II Question

Identify the function represented by the following power series.

[tex]\sum_{k = 0}^\infty (-1)^k \frac{x^{k + 2}}{4^k}[/tex]

Answers

With some rewriting, you get

[tex]\displaystyle \sum_{k=0}^\infty (-1)^k\frac{x^{k+2}}{4^k} = x^2 \sum_{k=0}^\infty \left(-\frac x4\right)^k[/tex]

Recall that for |x| < 1, you have

[tex]\displaystyle \frac1{1-x} = \sum_{k=0}^\infty x^k[/tex]

So as long as |-x/4| = |x/4| < 1, or |x| < 4, your series converges to

[tex]\displaystyle x^2 \sum_{k=0}^\infty \left(-\frac x4\right)^k = \frac{x^2}{1-\left(-\frac x4\right)} = \frac{x^2}{1+\frac x4} = \boxed{\frac{4x^2}{4+x}}[/tex]

Based on known expressions from Taylor series, the power series [tex]\sum \limits_{k = 0}^{\infty} (-1)^{k}\cdot \frac{x^{k+2}}{4^{k}}[/tex]Taylor series-derived formula of the rational function [tex]\frac{4\cdot x^{2}}{4+x}[/tex].

How to derive a function behind the approximated formula by Taylor series

Taylor series are polynomic approximations used to estimate values both from trascendental and non-trascendental functions. It is commonly used in trigonometric, potential, logarithmic and even rational functions.

In this question we must use series properties and common Taylor series-derived formulas to infer the expression behind the given series. Now we proceed to find the expression:

[tex]\sum \limits_{k = 0}^{\infty} (-1)^{k}\cdot \frac{x^{k+2}}{4^{k}}[/tex]

[tex]x^{2}\cdot \sum\limits_{k = 0}^{\infty} \left(-\frac{x}{4} \right)^{k}[/tex]

[tex]x^{2}\cdot \left(\frac{1}{1+\frac{x}{4} } \right)[/tex]

[tex]\frac{4\cdot x^{2}}{4+x}[/tex]

Based on power and series properties and most common Taylor series- derived formulas, the power series [tex]\sum \limits_{k = 0}^{\infty} (-1)^{k}\cdot \frac{x^{k+2}}{4^{k}}[/tex] represents a Taylor series-derived formula of the rational function [tex]\frac{4\cdot x^{2}}{4+x}[/tex]. [tex]\blacksquare[/tex]

To learn more on Taylor series, we kindly invite to check this verified question: https://brainly.com/question/12800011

Laura, Scott, and Joe served a total of 104
orders Monday at the school cafeteria. Joe served 3
times as many orders as Scott. Laura served 9
more orders than Scott. How many orders did they each serve?

Answers

9514 1404 393

Answer:

Joe: 57Scott: 19Laura: 28

Step-by-step explanation:

Let s represent the number of orders Scott served. Then we have Joe served 3s, and Laura served (s+9). The total of orders served is ...

  3s +s +(s +9) = 104

  5s = 95 . . . . . . . . . . . subtract 9 and collect terms

  s = 19 . . . . . . . . . divide by 5

  3s = 3×19 = 57

  s+9 = 19+9 = 28

Joe served 57 orders, Scott served 19, and Laura served 28 orders.

Other Questions
PLEASE PLEASE HELP PLEASE PLEASE HELP ME WITH THIS QUESTION PLEASE HELP PLEASE In the economy of Nocoin bank deposits are $ billion. Bank reserves are $ billion, of which two thirds are deposits with the central bank. Households and firms hold $ billion in bank notes. There are no coins. Calculate the monetary base and the quantity of money. Calculate the banks' desired reserve ratio and the currency drain ratio (as percentages). f(x) = (x - 5) (2x - 7) (7x - 3) has zeros at x = -3.5, x = 3/7, and x = 5. what is the sign of f on the interval 3/7 < x < 5 ? 1. f is always positive on the interval.2. f is always negative on the interval.3. f is sometimes positive and sometimes negative on the interval. Verify the identity.[tex]cot (x-\frac{\pi }{2})=-tan[/tex] Put the following equation of a line into slope-intercept form, simplifying allfractions.3x 9y = -72 Brianna's Bakery offers 3 flavors of bagels. Customers can choose from plain, cinnamon, or blueberry bagels. Yesterday, a customer ordered 144 bagels for a company meeting. The order was for twice as many blueberry bagels as plain bagels and 3 times as many cinnamon bagels as blueberry bagels.How many cinnamon bagels did the customer order Write the composite function in the form f(g(x)). [Identify the inner function u = g(x) and the outer function y = f(u).] $ y = e^{{\color{red}5}\sqrt{x}} $ Total Internal Reflection: A ray of light in glass strikes a water-glass interface at an angle of incidence equal to one-half the critical angle for that interface. The index of refraction for water is 1.33, and for the glass it is 1.43. What angle does the refracted ray in the water make with the normal P is inversely proportional DY. IF P=1.2=when y=100, calculatea the value of p when y=4b the value of y when p=3 Aprojectile, fired with unknown initial velocity, lands 20sec later on side of hill, 3000m away horizontally and 450m vertically above its starting point. a) what is the vertical component of its initial velocity? b) what is the horizontal component of velocity? Anyone please help me I need help ?!!!!!): A journal entry for a payment for rent expense was posted as a debit to Salaries Expense and a credit to Cash. Which of the following statements correctly states the effect of the error on the trial balance? A. The sum of the credits will equal the sum of the debits. B. The sum of the debits will exceed the sum of the credits by . C. The sum of the debits will exceed the sum of the credits by . D. The sum of the credits will exceed the sum of the debits by . First, find the length of each edge of the cube.Then, find the volume. Acidic amino acids have two -COOH and one -NH2 group per molecule. Select the pair that consists of acidic amino acida) Aspartic Acid , Glutamic Acidb) Lysine , argininec) Glycine and alanined) Both a and b Which table represents a linear function? What is the initial value of the sequence?1238 Suppose that a company has the following accounts receivable collection pattern: Paid in the month of sale 25% Paid in the month following sale 75% All sales are on credit. If credit sales for January and February are $250,000 and $120,000 respectively, the cash collection for February is: Page 1:Page 2:And though my head felt heavy,I played on till duskMissing flies and pop-ups and groundersAnd calling out in desperation things likeYours and take it, but doing all right,Tugging at my cap in just the right way,Crouching low, my feet set.Hum baby sweetly on my lips.How I Learned English,Gregory DjanikanCompare the original ending with the version in which most of the vivid language has been taken out. Write three to four sentences explaining how the original version helps you visualize and understand the poems story. A 25.00 gram sample of an unknown metal initially at 99.0 degrees Celcius is added to 50.00 grams of water initially at 10.55 degrees Celcius. The final temperature of the system is 20.15 degrees Celcius. Calculate the specific heat of the metal. (The specific heat of water is 4.184 J/g*C). A certain bell rings every 60 minutes. Another Bell rings every 90 minutes. Both bells begin ringing at midnight (12:00 a.m). How many more times will both bells ring by 1 p.m