The reason why 1-hydroxy-2-methyl-5-isopropylbenzene is not the correct systematic name for carvacrol is because the substituents are not listed alphabetically.
IUPAC nomenclature provides the correct and acceptable system of naming organic compounds which are internationally acceptable among scientists.
According to the rules of IUPAC nomenclature, compounds are named in alphabetical order. The names of the locants are ordered in such a way that they have the lowest number. Following IUPAC nomenclature, the correct name of the compound ought to be, 1-hydroxy-5-isopropyl-2-methylbenzene.
Learn more: https://brainly.com/question/11587934
What determines an object’s ability to float?
The temperature at which a solid melts is the same as the temperature at which its liquid form solidifies (true or false)
Answer:
True I think so
Explanation:
I have asked question in my profile please tell me the answer
A(1,2),B(1,4),C(6,2),
Answer:
????
Explanation:
where's the question
Which location in the diagram above is the Northern Hemisphere experiencing summer?
Location A
Location B
Location C
Location D
Answer:
c
Explanation:
Answer:
Location b is experiencing summer
In the Northern Hemisphere, Summer season is represented here location B.
How do ionic bonds differ from covalent bonds?
Which has more calories: table sugar or aspartame?
Answer:
Aspartame produces 4 kilocalories of energy per gram when metabolized, sucrose (table sugar) produces 3.9 kilocalories. However, aspartame is approximately 200 times sweeter than sucrose, so it is consumed in much smaller doses.
Explanation:
Answer is Aspartame.
helpppppppppppppppppppppppppp
Answer:
B
Explanation:
Answer:
B
Explanation:
U can read the second part
6. What is true about Calcium (Ca)?
A. It is a very unreactive metal.
B. It is reactive and is found with nonmetals in nature.
C. naturally uncombined with other elements.
D.It is a very reactive nonmetal.
Answer:
C. naturally uncombined with other elements.
Explanation: Calcium is a chemical element with the symbol Ca and atomic number 20. As an alkaline earth metal, calcium is a reactive metal that forms a dark oxide-nitride layer when exposed to air.
Tin has the atomic number Sn (Z = 50).
(a). Give its electronic structure
(b). Is it one of the transition metals?
(c). Knowing that it loses its electrons in pairs and that the 4d subshell is not affected. What are the possible degrees of oxidation for this element?
Tin has electron configuration [Kr] 5s²4d¹⁰5p² and it is not a transition element because its outermost orbitals are 5s² 5p². It has oxidation states of +2 and +4.
The electron configuration of tin is [Kr] 5s²4d¹⁰5p². The electronic structure of an atom shows the arrangement of electrons in the atom of an element. The electrons are arranged in sub-shells.
Tin is not a transition metal because it has a completely filled d sub-shell and its outermost shell consists of ns, np orbitals.
Tin looses its electrons in pairs. Remember that the outermost orbitals are 5s² 5p². This means that tin can have two stable oxidation states, +2 and +4.
Learn more: https://brainly.com/question/10079361
Rank the given objects from having the biggest size to the smallest size Blood cells , virus, atom, electrons , paper
Answer:
paper, blood cell, virus, electron, atom
Explanation:
50 Points (Brainliest too)! Please help!
1. In detail, explain what transmutation is.
2. In one to two sentences, explain what an alpha particle is.
3. Explain the difference between a chemical equation and a nuclear equation.
4. What is the relationship between the atomic number and the mass number of a 5. nucleus?
Please help me understand these!! I'm really confused!
Answer:
Transmutation is the conversion of an atom of one element into an atom of a different element through nuclear changes.
An alpha particle is a particle composed of 2 protons and 3 neutrons. It results from transmutation because of the change in protons in a large nucleus.
A chemical equation is balanced accord to the number of atoms of each element before and after the change. This is also shows the Law of Conservation of Matter.
A nuclear equation is balanced according to mass number and charge (atomic number). These equations can’t be balanced like chemical equations because the identities of the atoms can change. On the left of equation, the top number is the atomic mass and the bottom number is the atomic number. Take note that if you add the atomic mass (top number), you’ll get the the atomic mass of of the atom pre-transmutation. Same applies with atomic number. This shows a balanced nuclear equation.
The atomic number is the number of protons in a nucleus. The mass number is the sum of the protons and neutrons in a nucleus. Electrons have very small masses, so they are not accounted in atomic mass.
What is the atomic mass of Helium
Answer:
4.002602 u
Explanation
Answer:
4.002602 u
Explanation:
Plss answer!!! I need help fast
Answer:
2 Na atoms
1 C atom
3 O atoms
gram formula weight = 105.99 g
hope this helped :)
Explanation:
→ Na
# of Atoms - 2
→ C
# of Atoms - 1
→ O
# of Atoms - 3
→ gram formula weight (g) : 105.99 g
does xef4 have resonance structure?
Answer:
Yes
Explanation:The structure of XeF4 is square planar.
What are the law of 10 in energy Transfer
Answer:
When the energy is passed on from one trophic level to another, only 10 percent of the energy is passed on to the next trophic level.
Explanation:
What happens when the compound CaCl2 forms?
Explanation:
Calcium gives valence electrons to both chlorine atoms so that they have a full outer shell.
classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2
The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.
A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.
In the reaction;
Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)
We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.
Learn more: https://brainly.com/question/5624100
What do the five senses do I want a expert vefired type of Answer
Answer:
Humans have five basic senses: touch, sight, hearing, smell and taste. The sensing organs associated with each sense send information to the brain to help us understand and perceive the world around us.
Explanation:
-How do the senses work? Your brain collects information, like smells and sounds, through your five senses: sight, hearing, touch, taste, and smell. Each of your five senses has its own special sensor. Each sensor collects information about your surroundings and sends it to the brain.
-Why is it important? The five senses, sight, taste, touch, hearing and smell all collect information about our environment that are interpreted by the brain. We respond almost automatically to most sensory information. Such response is important for survival in our environment.
I HOPE THIS HELPS!!!!
how many number of atoms are present in 0.55moles of calcium
Explanation:
The warmer and less dense air near the ground rises during the day pulling more air through the valley floor. This gentle upslope wind known as a valley breeze. ... The cooler and denser air at higher elevations flows back down the slopes of the mountain and into the valley. This is called a mountain breeze.29-May-2017

https://www.weathernationtv.com › ...
Mountain and Valley Breezes - WeatherNation
Feedback
About featured snippets
Mountain breeze and valley breeze
Images










View all
Description
A mountain breeze and a valley breeze are two related, localized winds that occur one after the other on a daily cycle. They are not the same as anabatic and katabatic winds, which are larger and stronger. These winds are opposite from each other. Wikipedia
What is the molarity of 98.0 g of phosphoric acid, H3PO4 in 1.00 L of solution. Please show your work.
Answer:
1.0001 M
Explanation:
Molarity = Mass/(Volume x molar mass)
Molarity = 98.0 g/(1.00 L x 97.994 g/mol)
Molarity = 1.0001 M
the molarity of 98.0 g of phosphoric acid, H3PO4 in 1.00 L of solution is 1.0001 M
what is the difference between molarity and molality ?Molarity can be defined as the number of moles of solute available in a definite concentration and amount of the solution, other wise called as moles per liters of a solution.
Molality of a solution can be defined as the number of moles per solute can be present in a kilogram of the solvent, which is moles per kilogram of a solvent.
Though the terms Molarity and Molality are quite similar but the sharp difference between them as it creates a huge difference while using this two form of calculation for various calculations.
Molarity = Mass/(Volume x molar mass)
Here, Molarity = 98.0 g/(1.00 L x 97.994 g/mol)
Molarity = 1.0001 M
learn more on molarity, here:
https://brainly.com/question/16727614
#SPJ2
how many grams of hydrogen in 1.85moles
1. Oxygen was discovered by Joseph Priestley in 1774 when he heated mercury (II) oxide, HgO, to decompose it to form its constituent elements. How many moles of mercury (II) oxide are needed to produce 125 g of oxygen?
Given:
Unknown:
Mole ratio:
Solution:
2. In a blast furnace, iron (III) oxide is used to produce iron by the following (unbalanced) reaction:
Fe2O3(s) + CO(g) Fe(s) + CO2(g)
If 4000 g of Fe2O3 is available to react, how many moles of CO are needed?
Given:
Unknown:
Mole ratio:
Solution:
Final answer:
ugh pls help:(
Answer:
1. 7.81 moles HgO
2. n = mass/molar mass = (4000 g)/(159.69 g/mol) = 25.05 mol.
Explanation:
How many moles of mercury (II) oxide are needed to produce 125 g of oxygen?
2HgO ==> 2Hg + O2
125 g O2 x 1 mol O2/32 g x 2 mol HgO / mol O2 = 7.81 moles HgO
------------------------------------------------------------------------------------------------------------
If 4000 g of Fe2O3 is available to react, how many moles of CO are needed?
The no. of moles of CO are needed = 75.15 mol.
Fe₂O₃ + 3CO → 2Fe + 3CO₂,
It is clear that 1 mol of Fe₂O₃ reacts with 3 mol of CO to produce 2 mol of Fe and 3 mol of CO₂.
If 4.00 kg Fe₂O₃ are available to react, how many moles of CO are needed?
We need to calculate the no. of moles of 4.00 kg Fe₂O₃:
n = mass/molar mass = (4000 g)/(159.69 g/mol) = 25.05 mol.
Using cross multiplication:
1 mol of Fe₂O₃ need → 3 mol of CO to react completely, from stichiometry.
25.05 mol of Fe₂O₃ need → ??? mol of CO to react completely.
The no. of moles of CO are needed = (3 mol)(25.05 mol)/(1 mol) = 75.15 mol.
According to the periodic table, which two elements have an atomic mass less than twice their atomic number?
Answer:
Hydrogen and oxygen
Explanation:
Hydrogen
2 × atomic number = 2
atomic mass = 1.008 amu
Oxygen
2 × atomic number = 16
atomic mass = 15.999 amu
introduced in the 13th-16th? century from sabah in the reign of the sultanate of sulu, and became extinct on maguindanao or were transported back to sabah. Bone fragments are the only proof left behind of their existence ...ill mark u as brainliest
The Elephant Maximus is the species that was introduced and later became extinct on Maguindanao.
Extinction occurs as all members of a species die, and therefore the species disappears. This includes complete extinction or extinction of the species in a specific zone.
In the case of the Elephant Maximus, which is known as the Asian Elephant, this species became extinct in a region known as Maguindanao in the Philippines.
This partial extinction occurred as the elephants from this zone were taken to Sabah in Malaysia from the 13th century to the 16th century. This occurred because the Sultans of this region considered this elephant to be a valuable and even sacred animal.
Learn more in: https://brainly.com/question/14698336
Low tides are located at___
A an C
A an B
B an D
Answer: A and C
Explanation:
Low tides occur in locations at 90 degree angles to the moon. Tidal cycles have the same length as the lunar day, 24 hours and 50 minutes. In this time span, most locations will experience two high tides, when the location is close to and far from the moon, and two low tides. Sides A and C are angled 90 degrees from the moon.
Hence, low tides are located at A and C.
Answer:90 degree angles to the moon.
Explanation:
Determine whether the bonds in CCl4 and N2 are polar or non-polar. If the bond is polar, assign the partial positive and negative charges. Electronegativity values: C = 2.5, Cl= 3.0, N= 3.0
Refer to the attachment
According to the molecular geometry, bonds in carbon tetrachloride are polar and that in nitrogen are non polar.
What is molecular geometry?Molecular geometry can be defined as a three -dimensional arrangement of atoms which constitute the molecule.It includes parameters like bond length,bond angle and torsional angles.
It influences many properties of molecules like reactivity,polarity color,magnetism .The molecular geometry can be determined by various spectroscopic methods and diffraction methods , some of which are infrared,microwave and Raman spectroscopy.
They provide information about geometry by taking into considerations the vibrational and rotational absorbance of a substance.Neutron and electron diffraction techniques provide information about the distance between nuclei and electron density.
Learn more about molecular geometry,here:
https://brainly.com/question/7558603
#SPJ2
HELPPPPPP
Calculate the frequency of light with a wavelength 559nm
Answer:
Refer to the attachment
Look at the numbered locations. Our solar system can be found at_____
Location 1
Location 2
Location 3
Location 4
Answer:
location 3...........
b. How does government funding affect scientific progress? (1 point)
Answer:
29 percent of federal R&D money goes to universities, 29 percent goes to industry, and another 29 percent goes to researchers who work directly for federal agencies. About 10 percent goes to federally funded labs operated by private contractors.
Answer:
Explanation:
Funding from the government greatly affects the scientific research as a research can take number of years to complete. During this time period lot of financial support is required as there might be lot of expensive chemicals or substance that the scientist requires for his research.
state what method you would use the separate water from a potassium iodide solution
Answer:
You can separate the Iodine from the water and convert the potassium iodide into elemental Iodine by mixing 1 part of a 5–13% solution of Iodine/Potassium Iodide with 1 part distilled water and 1 part 3% Hydrogen Peroxide Solution followed by 1/12 part 32.45% hydrochloric (Muriatic) acid.
