Answer:
c
Explanation:
c .
answer
your
this
questions
Synthetic reactions in Citric Acid Cycle
★ « Synthetic reactions in Citric Acid Cycle » ★
The overall reaction for the citric acid cycle is as follows: acetyl-CoA + 3 NAD+ + FAD + GDP + P + 2H2O = CoA-SH + 3NADH + FADH2 + 3H+ + GTP + 2CO2. Many molecules in the citric acid cycle serve as key precursors for other molecules needed by cells.hope it is
lights of different frequencies make up
Answer:
Light waves come in a continuous variety of sizes, frequencies and energies, a continuum known as the electromagnetic spectrum. Once Maxwell introduced the concept of electromagnetic waves, everything clicked into place.
Explanation:
Hope this helps:)
~Kisame'sAbs
Which temperatures originally represented the fixed points
Celsius temperature scale?
Answer:Since 1743 the Celsius scale has been based on 0 °C for the freezing point of water and 100 °C for the boiling point of water at 1 atm pressure. Prior to 1743 the values were reversed (i.e. the boiling point was 0 degrees and the freezing point was 100 degrees).
Explanation: i no it
Look at the numbered locations. Our solar system can be found at_____
Location 1
Location 2
Location 3
Location 4
Answer:
location 3...........
How do you prepare a demi-glace?
Answer:
Explanation:
sory i dont know
What is the molarity of 98.0 g of phosphoric acid, H3PO4 in 1.00 L of solution. Please show your work.
Answer:
1.0001 M
Explanation:
Molarity = Mass/(Volume x molar mass)
Molarity = 98.0 g/(1.00 L x 97.994 g/mol)
Molarity = 1.0001 M
the molarity of 98.0 g of phosphoric acid, H3PO4 in 1.00 L of solution is 1.0001 M
what is the difference between molarity and molality ?Molarity can be defined as the number of moles of solute available in a definite concentration and amount of the solution, other wise called as moles per liters of a solution.
Molality of a solution can be defined as the number of moles per solute can be present in a kilogram of the solvent, which is moles per kilogram of a solvent.
Though the terms Molarity and Molality are quite similar but the sharp difference between them as it creates a huge difference while using this two form of calculation for various calculations.
Molarity = Mass/(Volume x molar mass)
Here, Molarity = 98.0 g/(1.00 L x 97.994 g/mol)
Molarity = 1.0001 M
learn more on molarity, here:
https://brainly.com/question/16727614
#SPJ2
how many number of atoms are present in 0.55moles of calcium
Explanation:
The warmer and less dense air near the ground rises during the day pulling more air through the valley floor. This gentle upslope wind known as a valley breeze. ... The cooler and denser air at higher elevations flows back down the slopes of the mountain and into the valley. This is called a mountain breeze.29-May-2017

https://www.weathernationtv.com › ...
Mountain and Valley Breezes - WeatherNation
Feedback
About featured snippets
Mountain breeze and valley breeze
Images










View all
Description
A mountain breeze and a valley breeze are two related, localized winds that occur one after the other on a daily cycle. They are not the same as anabatic and katabatic winds, which are larger and stronger. These winds are opposite from each other. Wikipedia
How many molecules of NaCl are there per mL of the solution?
Explanation:
Nacl is an ionic compound, so there are no molecules only formula units please mark me brainlistLooking at the above diagram, which side would be considered an acid AND explain how do you know this?
Answer:
The side with lots of H+ and low pH
Explanation:
Because one of the feature of an acid is the ability to dissociate to H+.
And it has lower pH because the concentration of H+ is more than OH-
What are the substances you start with in a chemical reaction called?
A. The intermediates
B. The products
C. The mixture
D. The reactants
Tin has the atomic number Sn (Z = 50).
(a). Give its electronic structure
(b). Is it one of the transition metals?
(c). Knowing that it loses its electrons in pairs and that the 4d subshell is not affected. What are the possible degrees of oxidation for this element?
Tin has electron configuration [Kr] 5s²4d¹⁰5p² and it is not a transition element because its outermost orbitals are 5s² 5p². It has oxidation states of +2 and +4.
The electron configuration of tin is [Kr] 5s²4d¹⁰5p². The electronic structure of an atom shows the arrangement of electrons in the atom of an element. The electrons are arranged in sub-shells.
Tin is not a transition metal because it has a completely filled d sub-shell and its outermost shell consists of ns, np orbitals.
Tin looses its electrons in pairs. Remember that the outermost orbitals are 5s² 5p². This means that tin can have two stable oxidation states, +2 and +4.
Learn more: https://brainly.com/question/10079361
A volume of 10.0 mL of 25 mg/L Mn2+ solution was diluted to make a solution with the final volume of 50.0 mL. Calculate the concentration (in mg/L) of the final solution
Taking into account the definition of dilution, the concentration of the final solution is 5 mg/L.
First of all, you have to know that dilution is the reduction in concentration of a chemical in a solution. The process consists of adding more solvent to the same amount of solute.
In a dilution the amount of solute does not change, but as more solvent is added, the concentration of the solute decreases.
A dilution is mathematically expressed as:
Ci×Vi = Cf×Vf
where
Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volumeIn this case, you know:
Ci= 25 mg/L Vi= 10 mL Cf= ? Vf= 50 mLReplacing in the definition of dilution:
25 mg/L × 10 mL= Cf × 50 mL
Solving:
Cf= (25 mg/L × 10 mL)÷ 50 mL
Cf= 5 mg/L
In summary, the concentration of the final solution is 5 mg/L.
Learn more about dilution:
brainly.com/question/20113402?referrer=searchResults brainly.com/question/22762236?referrer=searchResultsRank the given objects from having the biggest size to the smallest size Blood cells , virus, atom, electrons , paper
Answer:
paper, blood cell, virus, electron, atom
Explanation:
helpppppppppppppppppppppp
Answer:
The process in which plants release water through their leaves back into the air
Explanation
Answer:
The process in which plants release water through their leaves back into the air.
Hope this helps!
List the steps in naming covalent compounds.
1. Name the non-metal furthest to the left on the periodic table by its elemental name.
2. Name the other non-metal by its elemental name and an -ide ending.
3. Use the prefixes mono-, di-, tri-.... to indicate the number of that element in the molecule.
4. If mono is the first prefix, it is understood and not written
Answer:
Rules for naming simple covalent compounds:
1. Name the non-metal furthest to the left on the periodic table by its elemental name.
2. Name the other non-metal by its elemental name and an -ide ending.
3. Use the prefixes mono-, di-, tri-.... to indicate the number of that element in the molecule.
4. If mono is the first prefix, it is understood and not written
Examples:
N2O4 is called dinitrogen monoxideCO2 is called carbon dioxideCO is called carbon monoxideN2O is called dinitrogen monoxide. (It is also called nitrous oxide but that is another naming scheme.)CCl4 is called carbon tetrachlorideHere is a chart of those prefixes:
1 - mono
2 - di
3 - tri
4 - tetra
5 - penta
6 - hexa
7 - hepta
8 - octa
9 - nona
10 - deca
Alex mixed soy sauce and vinegar and created mixture that has a uniform appearance all throughout. he also noticed that the components are not recognizable and are evenly mixed.Which type of mixture was he able to create
a.heterogeneous
b.homogeneous
c.solid in liquid
d.solid in liquid
Answer:
b.homogeneous
Can I have a Brainliest please?
Explanation:
Question 5 of 5
The rows in the periodic table are called periods. What is true about elements
in the same period?
O A. They have the same atomic mass.
B. Their atomic numbers increase by 1 from left to right.
C. Their magnetism increases in strength from left to right.
D. They have similar chemical properties.
SUBMIT
Answer:
B. Their atomic numbers increase by 1 from left to right
HELPPPPPP
Calculate the frequency of light with a wavelength 559nm
Answer:
Refer to the attachment
What happens when the compound CaCl2 forms?
Explanation:
Calcium gives valence electrons to both chlorine atoms so that they have a full outer shell.
how many grams of hydrogen in 1.85moles
Na is best known as a(n):
Answer:
sodium
Explanation:
sodium is an element with the atomic no. of 11 and atomic mass of approximately 23
What is the mass of a baseball that has kinetic energy of 105 and is traveling at 10 m/s
Answer:
K.E =1/2 Mass×(velocity)2
Explanation:
1/2mass=K.E/Velocity 2
1/2mass=105/(10m/s)2
1/2mass=105/100m/s
1/2mass=21/20m/s
mass=21/20m/s ×2
mass=21/10
mass=2.1 Kilogram (put the value)
In the following reaction, how many liters of oxygen will react with 270 liters of ethene (C2H4) at STP?
C2H4(g) + 3O2(g) 2CO2(g) + 2H2O(g)
The volume of one mole of gas at STP is 22.4 liters.
Select the statements that correctly describe an asteroid. Check all that apply
Largest of the space rocks found orbiting the Sun.
Smallest of the space rocks found orbiting the Sun.
most are found between Mars and Jupiter
most are found between Jupiter and Saturn
Answer:
Explanation:
Most of this ancient space rubble can be found orbiting the Sun between Mars and Jupiter within the main asteroid belt. Asteroids range in size from Vesta – the largest at about 329 miles (530 kilometers) in diameter – to bodies that are less than 33 feet (10 meters) across.
Rock salt is a mixture of salt (sodium chloride) and sand. Describe how you would separate rock salt to obtain salt crystals and pure dry sand. In this question you get marks for how well your answer is written. You will get marks for: spelling, grammar, organising your ideas and information clearly and using key scientific words.
Answer:
pour the rock salt mixture throught a filter made from paper and allow the liquid to filtrate .
Explanation:
Separating Sand and Salt
Probably the easiest method to separate the two substances is to dissolve salt in water, pour the liquid away from the sand, and then evaporate the water to recover the salt.
Pour the liquid through a paper filter made of rock salt mixture and let it filter, after complete filtration we obtain crystals of salt.
What is filtration?Filtration is defined as the technique of removing solid particles from a liquid or gaseous fluid by passing the fluid through a filter media while keeping the solid particles behind.
It can also be defined as a physical method that uses a filter media with a complicated structure that only allows fluid to pass through to separate solid matter and liquid from a combination.
There are six types of filtration.
Vacuum filtrationCentrifugal filtrationGravity filtrationCold filtrationHot filtrationMultilayer filtrationMixture is defined as a substance that is composed of two more chemical compounds or substances that do not chemically mix.
There are two types of mixture.
Homogenous mixtureHeterogenous mixtureThus, pour the liquid through a paper filter made of rock salt mixture and let it filter, after complete filtration we obtain crystals of salt.
To learn more about filtration, refer to the link below:
https://brainly.com/question/14530470
#SPJ2
classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2
The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.
A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.
In the reaction;
Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)
We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.
Learn more: https://brainly.com/question/5624100
50 Points (Brainliest too)! Please help!
1. In detail, explain what transmutation is.
2. In one to two sentences, explain what an alpha particle is.
3. Explain the difference between a chemical equation and a nuclear equation.
4. What is the relationship between the atomic number and the mass number of a 5. nucleus?
Please help me understand these!! I'm really confused!
Answer:
Transmutation is the conversion of an atom of one element into an atom of a different element through nuclear changes.
An alpha particle is a particle composed of 2 protons and 3 neutrons. It results from transmutation because of the change in protons in a large nucleus.
A chemical equation is balanced accord to the number of atoms of each element before and after the change. This is also shows the Law of Conservation of Matter.
A nuclear equation is balanced according to mass number and charge (atomic number). These equations can’t be balanced like chemical equations because the identities of the atoms can change. On the left of equation, the top number is the atomic mass and the bottom number is the atomic number. Take note that if you add the atomic mass (top number), you’ll get the the atomic mass of of the atom pre-transmutation. Same applies with atomic number. This shows a balanced nuclear equation.
The atomic number is the number of protons in a nucleus. The mass number is the sum of the protons and neutrons in a nucleus. Electrons have very small masses, so they are not accounted in atomic mass.
does xef4 have resonance structure?
Answer:
Yes
Explanation:The structure of XeF4 is square planar.
Which location in the diagram above is the Northern Hemisphere experiencing summer?
Location A
Location B
Location C
Location D
Answer:
c
Explanation:
Answer:
Location b is experiencing summer
In the Northern Hemisphere, Summer season is represented here location B.
What is the density of a gas with a volume of 5.6 FL oz. and a mass of 37 grams?
Answer:
6.60
Explanation:
