define the term bio technology?​

Answers

Answer 1
mark me brainiest

Biotechnology is a branch of technology that uses biological systems, living organisms, or parts of them to develop or produce various products. Brewing and baking bread are examples of biotechnology processes (the use of yeast (= living organism) to produce the desired product).

Related Questions

PLEASE NELP ASAP

What was the purpose of the experiment?
Type your answer here:
How can you identify the gas produced in a chemical reaction without observing the atoms and molecules directly? Explain.
Type your answer here:
Write a hypothesis based on observations and scientific principles.
Type your answer here:
Experimental Methods
What tools or materials did you use to collect your data?
Type your answer here:
Describe the procedure that you followed to conduct your experiment.
Type your answer here:
Data and Observations
Record your observations.
Type your answer here:
Conclusions
What conclusions can you draw about the identities of the gases produced in each chemical reaction? Write an evidence-based claim.
Type your answer here:
Based on your observations, which equation best models the reaction of vinegar (C2H4O2) and baking soda (NaHCO3)? Explain.

Answers

Answer:

What was the purpose of the experiment?  

Type your answer here: The purpose of the experiment was to perform and observe the results of a variety of chemical reactions. To become familiar with the observable signs of chemical reactions. To identify the products formed in chemical reactions and predict when a reaction will occur. To write balanced equations for the reactions studied.

Explanation:

sorry i can only tell you the first one

Introduction

What was the purpose of the experiment?

The purpose of this experiment is to create CO2, also known as carbon dioxide, and observe chemical reactions.

How can you identify the gas produced in a chemical reaction without observing the atoms and molecules directly? Explain.

If I look at how the gas would react or its qualities, I can identify the gas without having to observe its atoms directly.

Write a hypothesis based on observations and scientific principles.  

I hypothesize that the mixture produced carbon dioxide, an acidic and colorless gas. In addition to organic materials, such as leaves and dirt, carbon dioxide is also produced when they decay.

Experimental Methods

What tools or materials did you use to collect your data?

To conduct my experiment, I used a glass cup, baking soda, vinegar, paper to record my observations, and a match.

Data and Observations

Record your observations.  

The baking soda and vinegar made bubbles and some steam. When I put the match above the glass, the flame went out.

Conclusions

What conclusions can you draw about the identities of the gases produced in each chemical reaction? Write an evidence-based claim.

The chemical reaction of CO2 caused the flame to go out.

Based on your observations, which equation best models the reaction of vinegar (C2H4O2) and baking soda (NaHCO3)? Explain.

"C" _"2"  "H" _"4"  "O" _"2" +"NaHC" "O" _"3" →"Na" "C" _2 H_3 "O" _"2" + "H" _2 "O"+"C" "O" _2

"C" _"2"  "H" _"4"  "O" _"2" +"NaHC" "O" _"3" →"Na" "C" _2 H_3 "O" _"2" + "H" _2 "O"+"O" _2

"C" _"2"  "H" _"4"  "O" _"2" +"NaHC" "O" _"3" →"Na" "C" _2 H_3 "O" _"2" + "H" _2 "O"+"H" _2

"C" _"2"  "H" _"4"  "O" _"2" +2"NaHC" "O" _"3" →"Na" "C" _2 H_3 "O" _"2" + "H" _2 "O"+"C" "O" _2

The equation that best models the reaction of vinegar is A

Because "C" _"2"  "H" _"4"  "O" _"2"  is the acid vinegar

"NaHC" "O" _"3"   is the baking soda  

"Na" "C" _2 H_3 "O" _"2" + "H" _2 "O"+"C" "O" _2 is the product or the reaction.

help pls pls help dfmndbfndsbfnsdmfbmnbfbnmdbfmn

Answers

Help with what? I don’t see picture

What do you need help with?

Population Dynamo
1
A population of alligators lives in a wetland habitat. Which of these describes a density-dependent factor that could affect this
population?
OA. A drought that lasts for several months occurs.
ОВ.
A hurricane passes through the area.
OC. Humans introduce pollutants into the water of the ecosystem.
OD
There is a decrease in prey animals in the ecosystem.
Reset

PLEASE NEED HELP
Submit

Answers

Answer:

D) there is a decrease in prey animals in the ecosystem

Explanation:

a density dependent factor is one of the following:

dieses

competition

predation

only one makes sense answer is D)

4. (3 pts.) In aerobic respiration, oxygen is necessary to accept the final electrons at the end of
the electron transport chain. What happens when a person cannot bring oxygen into the body
(maybe they stop breathing)? What energy molecule will not be generated? How will this affect
the organism?

Answers

Answer:

their body starts shutting down and this will cause slow and painful death

Explanation:

Question 4
Each individual bundle of muscle cells is called a

Answers

Answer: a fasciculus

I am not sure but I think Quizlet is the right answer

Erythrocytes live for a maximum of.......days whereas platelets live for ....... days

Answers

Answer:

[tex]120 \: days;10 \: days.[/tex]

Explanation:

Thanks!!!!!

Who is more closely related, lizards of the same ecomorph, or lizards that live on the same island?​

Answers

Answer:

The DNA evidence suggests that species from the same island are more closely related than are species from the same ectomorph group.

Explanation:

This finding supports the hypothesis that most of the lizards on each island evolved independently, in a process of convergent evolution, although there are exceptions.

What is the endosymbiotic hypothesis?

Answers

Answer:According to the Endosymbiotic Theory, the mitochondria and chloroplast in eukaryotic cells were originally aerobic bacteria (prokaryotes) that were consumed by a huge anaerobic bacterium (prokaryote).

Symbiogenesis, endosymbiotic theory, or serial endosymbiotic theory, is the leading evolutionary theory of the origin of eukaryotic cells from prokaryotic organisms

Which of the following BEST describes the hydrosphere?
WILL GIVE BRAINLIEST

A. bodies of water on the surface of Earth, but not the water in the atmosphere or underground

B. salt water in the oceans, but not fresh water

C. water that is underground or mixed into the geosphere

D. water in any location on Earth, including the atmosphere, surface, and underground

Answers

Answer:

A hydrosphere is the total amount of water on a planet. The hydrosphere includes water that is on the surface of the planet, underground, and in the air. ... The frozen part of Earth's hydrosphere is made of ice: glaciers, ice caps and icebergs. The frozen part of the hydrosphere has its own name, the cryosphere.

Most people have observed it "rain" in the produce department of grocery stores, where water sprays green leafy
vegetables from a misting system. How does this practice help to keep vegetables fresh and crisp?
A)
-B)
Extra water makes plants shiny, increasing the likelihood that consumers
will purchase the plants.
Extra water creates a hypotonic solution around plant cells, which causes
water to diffuse into the cell creating turgor pressure.
Extra water creates a hypertonic solution around plant cells, which causes
water to diffuse out of the cell plasmolysing the cells.
Extra water creates an isotonic solution around plant cells, which causes
water to diffuse into and out of the plant cells making them flaccia,
D)

Answers

Answer:

B is the answer

Explanation:

I just took the test

Question 8
1 pts
s
When a person jumps off the diving board and they spread their whole body out in the
air, they will hit the water with a loud smack. This is called a "belly flop". This is due to a
unique property of water called
O capillary action
O surface tension
Odensity
O temperature
< Previous
Next >

Answers

Answer:

Surface Tension

Explanation:

Why is fungi classified as neither a plant nor animal

Answers

Answer:

it is a decomposer

Explanation:

it is not a plant nor an animal it decomposes dead plants and animals

What was the universe immediately before the Big Bang occurred?

a black hole

a singularity

a super spiral galaxy

a mass of antimatter

Answers

the answer is a black hole

The universe immediately before the Big Bang occurred as a black hole. Thus, the correct option is A.

What is the Big bang?

The big bang may be defined as the cosmic explosion that significantly marked the initiation of the universe according to the big bang theory. The origin of the universe is explained by the Big Bang theory.

At initial, the whole universe appeared like a black hole where no life is present. It was all the dark around each and every corner. The universe was an infinite stretch of ultrahot, dense material and everything consisted of empty space.

Before the big bang, the universe was almost infinitely small, dark, and a size less than a trillionth of a second. It was a period of inflation which is followed by a more catastrophic event which was violent, and known as the period of expansion.

Therefore, the universe immediately before the Big Bang occurred as a black hole. Thus, the correct option is A.

To learn more about the Big bang theory, refer to the link:

https://brainly.com/question/1638518

#SPJ2

6. Why can't water be used to dissolve the
caffeine found in coffee and tea?

Answers

Caffeine or supercritical carbon dioxide is a less polar compoundWater is highly polar solvent.So water can't dissolve caffeine much.

Alcohol is used to extract caffeine

Tea's chief component is cellulose, which is not soluble in water. Caffeine is water soluble, but so are tannins and gallic acid, which have been established during the heating process of tea leaves. The latter two components can be converted to insoluble in water calcium salts.

What is solubility?

The maximum amount of a substance that will dissolve in a given amount of solvent at a given temperature is defined as solubility.

Solubility is a property of a specific solute-solvent combination, and the solubilities of different substances vary greatly.

It is one of the critical parameters for achieving the desired drug concentration in systemic circulation for the desired (anticipated) pharmacological response.

Caffeine is more soluble in nonpolar methylene chloride than in water, so it will migrate to the methylene chloride layer (known as the organic layer). Because the organic layer is denser than water, it will be at the bottom.

Thus, water can not be used to dissolve the caffeine found in coffee and tea.

For more details regarding solubility, visit:

https://brainly.com/question/8591226

#SPJ2

Give the Chemical name of four commercial fertilizers.

Answers

Answer:

urea(contains nitrogen),sodium nitrate,Ammonium Sulphate ,Muriate of Potash.

Explanation:

in single celled organisms diffusion is sufficient to meet all their requirements of food, exchange of gasses or removal of waste but it is not in case of multicellular organisms. explain the reason for this difference​

Answers

Answer:

Diffusion is a very slow process. If multicellular organisms used diffusion to meet all requirements of food, exchange of gases or removal of wastes it would take too much of time for carrying.

Explanation:

A white rooster (WW) is crossed with a black-and-white-speckled hen (Ww).
The hen lays eight eggs. Draw a Punnett square to show the possible genotypes of
the chicks that will hatch.

Answers

Answer:

The genotypes are shown in purple

Hope this helps!

A white rooster (WW) is crossed with a black-and-white-speckled hen (Ww).

The hen lays eight eggs.

What is incomplete dominance?

Incomplete dominance is a form of Gene interchange in which both alleles of a gene at a locus are somewhat expressed, often resulting in a medium or separate phenotype.

It is also known as partisan dominance.

For Example in roses, the allele for red colour is dominant over the allele for white colour.

Thus, A white rooster (WW) is crossed with a black-and-white-speckled hen (Ww).

To learn more about incomplete dominance click here:

https://brainly.com/question/14053639

According to the figure, is this population more likely to grow slowly or quickly in the next 10 years

Answers

Answer:

There isn't enough information to answer this question. Maybe if you add the figure I would be able to help you get an answer. Have a good day :)

Explanation:

5. What is the optimal pH for both enzymes in the picture? Where do you think they are found in the body? Enzyme Activity *Trypsin + Pepsin 9 11 3 十7 5 pH Figure 1. Activity levels of two digestive enzymes over a range of pH​

Answers

F Jan do his koool. Yes

List ten structure you coul find in an electron micro graphy of an animal cell would be absent from the cell of bacteria

Answers

Answer:

Bacteria (prokaryotic) do. not have membranes bound organelles.

therefore it doesn't have nucleus (hasa nuclied instead).no mitrochondira. no gogli appraratus,no

endoplasmic reticulum.

Explanation:

up is the explanation.

I hope you all like this answer quys

Mark as brainlist

rate this answer quys

thank you ❤️

Why are amino acids called amino acids?

Answers

Answer:

The name “amino acid” is derived from the amino group and carboxyl-acid-group in their basic structure. There are 21 amino acids present in proteins, each with a specific R group or side chainAll organisms have different essential amino acids based on their physiology.

Answer:

Because they are made of an amino group (NH3) and carboxylic acid group ( COOH)

= amino acid

Explanation:

Would pressure be greater or smaller if you were to go scuba diving? Explain

Answers

The farther you go down into the bottom of the ocean the harder the pressure gets, so I think the answer would be greater

It depends on how deep you go, the deeper you go the greater the pressure gets, ._.

If you are scuba diving in a coral reef there is little to no pressure since you are close to the surface, you are at surface floor

Which statement isn't true?

Answers

Answer:

I'm pretty sure the answer is b. Cells can absorb food and oxygen

Letter B is wrong “cells can absorb food and oxygen”

What is the first step in the scientific
method?
A. making an observation
B. developing a hypothesis
C. creating an experiment
D. writing a theory

Answers

Answer:

b. developing a hypothesis

PA answer plss
Tama o Mali
1.nang bubbly NG kapwa

Answers

Answer:

mali

Explanation:

masama po ang mang bully ng kapwa natin

Answer:

*bully?? Mali,kase di dapat binubully Yung kapwa

Pollution has negative effects on plants, animals, and people. Which choice would be least likely to cause water pollution?

Answers

Answer:

plants

Explanation:

because animals can maybe poop or pee on the water .and also people are the same too.so plants are the least likely to cause water pollution

What's the definition of epista
sis

Answers

Epistasis is genetic phenomenon that is defined by an interection of genetic variation loci

Answer:

(Hope this helps can I pls have brainlist (crown)☺️)

Explanation:

The interplay of genes that determines phenotype is known as epistasis. Genes may either hide each other, making one "dominant," or they can mix to create a new characteristic. It's the conditional link between two genes that can determine a single phenotype for certain features.

Epistasis is a term used in genetics to describe the interaction of genes at two or more loci, as a consequence of which the gene's impact is influenced by the presence of one or more modifier genes. One gene or allele in the interaction is obscuring the phenotypic expression of the other genes or alleles. Epistatic refers to the gene or allele that masks the impact. The other gene(s) or allele(s) being masked, on the other hand, is/are referred to as hypostatic. Epistasis can be dominant or recessive. The fur colour of Labrador retrievers, which is a polygenic feature, is an example of epistasis. Its fur colour is determined by the interaction of two genes.

Which of the following allows water to move much faster across cell membranes? A) the sodium-potassium pump B) ATP C) peripheral proteins D) aquaporins

Answers

Answer:

D

Explanation:

I believe the answer would be aquaporins

Aquaporins efficiently speed up the total rate of water diffusion across the cell membrane due to the slow diffusion of water through the lipid bilayer, hence option D is correct.

What are aquaporins?

Aquaporins (AQP) are essential membrane proteins that act as conduits for the passage of water and, occasionally, tiny solutes.

The Na+ K+ pump is an electrogenic transmembrane ATPase that was initially identified in 1957. It is located on the cytosolic side of the cell's outer plasma membrane. For every ATP, the Na+ K+ ATPase pumps 3 Na+ out of the cell and 2K+ into the cell.

Therefore, animals, plants, and microorganisms all have them preserved. Every aquaporin molecule has a pore in the middle, according to structural investigations of the molecules.

Learn more about aquaporins, here:

https://brainly.com/question/29971412

#SPJ6

You have a friend who became stranded in a blizzard without food for
several weeks. This friend, when rescued, had lost about 7 kg (about 15
Ibs). As he was quite healthy to begin with, he assumed the weight he
lost was stored fat, but he wondered where the fat had gone, How did
the fat leave his body?

Answers

The fat didn't really leave his body. Fat was converted to glucose in the gluconeogenesis pathway to give him energy during the period of starvation.

Fat is stored in the body in the adipose tissue. Fat plays so many roles in the body such as;

Protection of vital organsInsulating the body from coldServing as an energy store

In times of starvation, fact could also be broken down to release energy. This occurs when fat is broken down to glycerol and fatty acids. When this occurs, glycerol goes to the liver where it is converted to glucose in the gluconeogenesis pathway. This helps to produce energy in times of starvation thereby depleting the body's fat reserve.

As this process occurs, the fat reserve in my friend's body kept going down resulting in his loss of about 15  Ibs of weight.

Learn more: https://brainly.com/question/15362685

Describe the elements and compounds of coal being mined

Answers

Answer:

The organic compounds in coal are composed of the elements carbon, hydrogen, oxygen, nitrogen, sulfur, and trace amounts of a variety of other elements

Coal is a mixture of organic compounds and minerals formed from ancient plant material, primarily composed of carbon, hydrogen, and impurities like sulfur and nitrogen.

Coal is a mixture of organic compounds and minerals, resulting from the decomposition of ancient plant material over millions of years. It primarily consists of carbon, hydrogen, oxygen, nitrogen, and sulfur. Carbon, the dominant organic compound, makes up a substantial part of coal's composition, with hydrogen and oxygen occurring in lesser amounts.

Nitrogen and sulfur are present as impurities, in the form of organic compounds and mineral components. Coal also contains inorganic minerals like quartz, clay, and pyrite, contributing to its ash content. Trace elements, such as mercury, arsenic, and lead, are present in low concentrations. The exact composition varies based on coal type and location, influencing its energy content and environmental impacts.

To learn more about minerals follow the link:

https://brainly.com/question/1333886

#SPJ2

The complete question is:

Describe the elements and compounds of coal being mined.

Other Questions
252- (426) + 18 can someone help me? How to write 9 and 15 thousandths in decimals Find the value of X. When does it have kinetic energy how to speak with foreigner? (they are from english) Fill in the blanks: 1. The peasants and indigenous communities hated the exploitative system of PLEASE HELP!!!Investigate the effect of heat on different foods. Find the independent and dependent variables. which of these is a criterion used to select a target market segment? how do you explain the Renaissance started from Italy ''If you implement this scheme, we shall have no choice but to go on strike.''''_____, we must implement the schemeA: Be that as if may be C: Though it be thusB may that be as it is D: While that be so M if your tires have less than 30% of tread remaining, your stopping distance will be ___ compared to new tires Based on their composition and structure, list CH3COCH3CH3COCH3, CH3CH(CH3)CH3CH3CH(CH3)CH3, and CH3COOHCH3COOH in order of decreasing intermolecular forces. Can anyone help me with this question? PLSSS HELP ME OUTTT!! Which statement best describes a physical change? A. Changes can occur to certain chemical properties of the substance, but the overall shape of the substance will remain the same. B. Changes can occur to certain physical properties of the substance, but the overall shape of the substance will remain the same. C. Changes can occur to physical properties of a substance, but the chemical composition of the substance remains the same. D. Changes can occur to chemical properties of a substance, but the chemical composition of the substance remains the same. Selesaikan persamaan linear serentak berikut.2x + y = -53x - 4y = 9 which equation could be solved using the graph above Champagne was made in France change into interrogative When baking soda and vinegar react bubbles are produced. What mostly occurred?