Complete the recursive formula of the arithmetic sequence -15, -11, -7, -3,...−15,−11,−7,−3,...minus, 15, comma, minus, 11, comma, minus, 7, comma, minus, 3, comma, point, point, point. c(1)=c(1)=c, left parenthesis, 1, right parenthesis, equals c(n)=c(n-1)+c(n)=c(n−1)+c, left parenthesis, n, right parenthesis, equals, c, left parenthesis, n, minus, 1, right parenthesis, plus

Answers

Answer 1

Answer:

c(1) = -15

c(n) = c(n - 1) + 4

Step-by-step explanation:

Given arithmetic sequence is,

-15, -11, -7, -3...........

Common difference between each successive and previous term is,

d = -11 - (-15)

 = -11 + 15

 = 4

Since recursive formula of the arithmetic sequence is represented by,

a₁ = First term of the sequence

a(n) = a(n - 1) + d

where a(n) is the nth term and a(n-1) is the previous term of the nth term.

Form the given sequence,

c₁ = -15

c(n) = c(n - 1) + 4

Step-by-step explanation:


Related Questions

PLEASE HELP ASAP!!!!!

Answers

Step-by-step explanation:

Area ABC=1/2ab×sin C

=1/2 ×20×10 ×Sin C

Sin C =100

Larissa is ordering nachos at a restaurant, and the server tells her that she can have up to four toppings: ground beef, black beans, refried beans, and sour cream. Since she cannot decide how many of the toppings she wants, she tells the server to surprise her. If the server randomly chooses which toppings to add, what is the probability that Larissa gets just refried beans and sour cream

Answers

Answer:

0.0625

Step-by-step explanation:

Given that :

Number of toppings = 4 (ground beef, black beans, refried beans, and sour cream)

The probability of choosing any particular topping at random from the four is :

Probability = required / total possible outcomes

Hence, P = 1 / 4 = 0.25

Hence, the probability of choosing : getting refried bean and sour cream :

P(refried bean) = 1/4

P(sour cream) = 1/4

P(refried bean and sour cream) = 1/4 * 1/4 = 1/16 =

0.0625

How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse

Answers

Answer:

isosceles acute

Step-by-step explanation:

We have two sides that are equal so the triangle is isosceles

None of the angles are larger than 90 degrees so non of the angles are obtuse,  and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)

You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.

Answers

Answer:

[tex]35.36,44.64[/tex]

Step-by-step explanation:

Sample size [tex]n=40[/tex]

Mean weight [tex]\=x =67[/tex]

Standard deviation [tex]\sigma=11.4[/tex]

Confidence Interval [tex]CI=0.99[/tex]

\alpha==0.01

Therefore

[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]

From table

[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]

Generally, the equation for Margin of error is mathematically given by

[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]

[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]

[tex]M.E=4.64[/tex]

Therefore Estimated mean is

[tex]\=x-M.E<\mu <\=x +E[/tex]

[tex]40-4.64<\mu< 40+4.64[/tex]

[tex]35.36<\mu < 44.64[/tex]

[tex]35.36,44.64[/tex]

Please help, I'll give brainliest to the correct answer <3


A company recently purchased a new set of laser printers.

The value of the laser printers P, in dollars, t years after the purchase can be represented by the function P(t)=1,900(0.82)t.

Interpret the meaning of the function in the context of this situation.(1 point)


The initial value of the laser printers was $1,900, and the value increases by 82% each year.


The initial value of the laser printers was $1,558, and the value decreases by 82% each year.


The initial value of the laser printers was $1,558, and the value decreases by 18% each year.


The initial value of the laser printers was $1,900, and the value decreases by 18% each year.

Answers

Answer:

The initial value of the laser printers was $1,900, and the value decreases by 18% each year.

Step-by-step explanation:

Here ya go bestie <3

0.5 kilograms (kg) is equal to how many ounces? Round your answer to the

Answers

Answer:

17.637 ounces

Step-by-step explanation:

35.274 ounces is 1 kilogram so divide 35.274 by 2

Might want to keep the other guy Brainly

GIVING 25 POINTS AND BRAINIER IF ANSWERED!

What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.

Answers

The answer to your question is A

Answer:

B. The question may not be directly stated.

What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?

Answers

Answer:

17 units

Step-by-step explanation:

Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

Plug in the points and simplify:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]

[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]

[tex]d = \sqrt{225 + 64[/tex]

[tex]d = \sqrt{289[/tex]

[tex]d = 17[/tex]

So, the distance between the points is 17 units

Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)

Answers

Answer:

The zeroes of the function are: 3 and 4

Step-by-step explanation:

sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible​

Answers

= 2025

When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)

For this, you divide the given lengths using the numbers that divides all through.

I have added an image to this answer. Go through it for more explanation

the camdens drove 116 miles on 5 gallons of gas. at this rate, how many miles can they drive on 7 gallons of gas

Answers

Answer:

162.4 miles

Step-by-step explanation:

We can write a ratio to solve

116 miles            x miles

----------------- = ------------

5 gallons           7 gallons

Using cross products

116*7 = 5x

Divide by 5

812 /5 = 5x/5

162.4 =x

162.4 miles

HELP!!!!!!!!!!!!!!!!!!!
Calculate the future value of $2,500.00, earning interest at a rate of 2 1/2% that is compounded quarterly for 4 years.

A) $3,711.26


B) $2,563.09


C) $2,762.07


D) $5,910,086.00

Answers

Answer:

C) $2,762.07

you can use a compound interest calculator to find the answer

The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem

dN/dt = N(1 − 0.0008N), N(0) = 1.

Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?

Answers

Answer:

1250 supermarkets

Step-by-step explanation:

Given

[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]

[tex]N(0) = 1[/tex]

Required

Number of supermarkets over a long period of time

To do this, we simply set

[tex]\frac{dN}{dt} = 0[/tex]

So, we have:

[tex]N(1 - 0.0008N) = 0[/tex]

Split

[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]

Solve: [tex]1 - 0.0008N = 0[/tex]

Collect like terms

[tex]0.0008N = 1[/tex]

Make N the subject

[tex]N = \frac{1}{0.0008}[/tex]

[tex]N = 1250[/tex]

So:

[tex]\lim_{t \to \infty} N(t) = 1250[/tex]

Find the measure of the incanted angle to the nearest degree

Answers

Answer:

34⁰

Step-by-step explanation:

let unknown angle be x

cos x=19/23

cos x=0.826

x=cos inverse of 0.826

x=34.3⁰

A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.

Answers

Answer:

C

Step-by-step explanation:

Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later

Answers

Answer:

The rate at which the distance between the two cars is increasing is 30 mi/h

Step-by-step explanation:

Given;

speed of the first car, v₁ = 24 mi/h

speed of the second car, v₂ = 18 mi/h

Two hours later, the position of the cars is calculated as;

position of the first car, d₁ = 24 mi/h  x 2 h  = 48 mi

position of the second car, d₂ = 18 mi/h  x 2 h = 36 mi

The displacement of the two car is calculated as;

displacement, d² = 48² + 36²

                        d² = 3600

                        d = √3600

                        d = 60 mi

The rate at which this displacement is changing = (60 mi) / (2h)

                                                                                 = 30 mi/h

The diameter of a regulation soccer ball is about 8 and three-fifths inches. This number was graphed on a number line.

A number line going from negative 9 to positive 9. Point A is between negative 9 and negative 8, point B is between negative 7 and negative 6, point C is between 6 and 7, point D is between 8 and 9.

Which point could be the point representing the graph of the diameter of the ball?
A
B
C
D

Answers

Answer:

D

Step-by-step explanation:

8 and 3/5 = 8.2 and 8.2 is between 8 and 9 so the answer is D.

Find the x- and y-intercept of the line
X+4y=36

Answers

the answer:
(36,0) (0,9)

What is the value of x in the equation 5(3x + 4) = 23?

Answers

Answer:

x = 1/5

Step-by-step explanation:

5(3x + 4) = 23

Distribute

15x+20 = 23

Subtract 20 from each side

15x+20-20 = 23-20

15x = 3

Divide by 15

15x/15 = 3/15

x = 1/5

Answer:

[tex]x = 0.2[/tex]

Step-by-step explanation:

Step 1:  Distribute

[tex]5(3x + 4) = 23[/tex]

[tex](5 * 3x) + (5 * 4) = 23[/tex]

[tex](15x) + 20 = 23[/tex]

Step 2:  Subtract 20 from both sides

[tex](15x) + 20 - 20 = 23 - 20[/tex]

[tex]15x = 3[/tex]

Step 3:  Divide both sides by 15

[tex]\frac{15x}{15} = \frac{3}{15}[/tex]

[tex]x = \frac{1}{5}[/tex]

[tex]x = 0.2[/tex]

Answer:  [tex]x = 0.2[/tex]

Can someone please help me with part b ? It would be so appreciated you have no idea ;)

Answers

Answer:

absolutely yes, because pythagorean theorem is used in a right triangle

and when we match a line from the tee to the hole, we have a right triangle

Step-by-step explanation:

Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.

Answers

X - Y = 36 -> X = 36+ Y
3X + 2Y = 48 -> 3(36+Y)+2Y= 48-> Y = -12
X = 36-12= 24
X -2Y= 24-2.(-12) = 48

3/5x - 1/2x= 1, please help me to solve this ​

Answers

Answer:

x = - 10

Step-by-step explanation:

(6x -5x) / 10 = - 1

x = - 10

18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?

acute

obtuse

equiangular

right

Answers

Answer:

obtuse                    

aniuhafjhnfajfnha

Help please ….. help

Answers

Answer:

Step-by-step explanation:

a) categorical

b) add all of the numbers and divide by how many numbers there were.

c) outliers means any that were far away from the rest of the data

d) not entirely, you can make an estimate based on it, but nat an exact answer.

What is the amswerdkdmxmmdmdmdm

Answers

Answer:

HUH?

Step-by-step explanation:

Professor Iron always gives two exams in his communications class. He only uses the lower of the two scores that a student gets on the exams when he calculates the course grade. Put the grade on the first exam on the horizontal axis and the grade on the second exam on the vertical axis. What kind of preference a student should have for these two grades. Group of answer choices Perfect Complements Perfect Substitutes Cobb-Douglas Preference Neutral Preference

Answers

Answer:

Perfect complements

Step-by-step explanation:

Since minimum score of tests is to be considered. It is a case of perfect complements.

Correct option is

Perfect complements

Question 6 plz show ALL STEPS

Answers

Step-by-step explanation:

6a. Both the x and y coordinates are negative so this means isn't must be in the Third Quadrant.

6b. The measure of this using the unt circle is

[tex] \cos(x) - \frac{1}{2} [/tex]

[tex] \sin(x) = - \frac{ \sqrt{3} }{2} [/tex]

In the unit circle, this occurs about

an angle of 240 degrees. We can find coterminal angles within the interval of 2 pi to -2 pi. Just subtract 260 from theta.( which is 240)

[tex]240 - 360 = - 120[/tex]

So the angles in the interval is

240, -120.

6c. pi/2 is the same as 90 degrees so this means that

[tex](240 + 90) = 330[/tex]

In the unit circle, we know that at 330 degrees,

[tex] \cos(330) = \frac{ \sqrt{3} }{2} [/tex]

[tex] \sin(330) = \frac{1}{2} [/tex]

So the coordinates are

(sqr root of 3/2, 1/2).

6d. pi is the same as 180 degrees so this means that

[tex](240 - 180) = 60[/tex]

In the unit circle, we know that 60 degrees,

[tex] \cos(60) = \frac{1}{2} [/tex]

[tex] \sin(60) = \frac{ \sqrt{3} }{2} [/tex]

So the coordinates are

(1/2, sqr root of 3/2)

ou invested 7000 between two accounts paying 4% and 9% annual​ interest, respectively. If the total interest earned for the year was $430 how much was invested at each​ rate? ​$ nothing was invested at and ​$ nothing was invested at

Answers

9514 1404 393

Answer:

$3000 at 9%$4000 at 4%

Step-by-step explanation:

Let x represent the amount invested at 9%. Then 7000-x was invested at 4% and the interest earned was ...

  9%·x +4%(7000-x) = 430

  5%·x +280 = 430 . . . . . . . . . simplify

  0.05x = 150 . . . . . . . . . . . subtract 280

  x = 3000 . . . . . . . . . . divide by 0.05

$3000 was invested at 9%; $4000 was invested at 4%.

Help me! Thanks!!!!!!

Answers

Answer:

there are infinite solutions

Step-by-step explanation:

if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system

Other Questions
PLEASE HELP!!!!!!!!Which phrase best describes the context of a speech?A. The crowd's overall feelingsB. The visual aids the speakly usesC. The quality of the fact-checkingD. The evidence the speech presents Which ordered pair is in the solution set of 3x 2y -1? F.(-2, -2.5) G.(-1, 1) H.(2, 4) J.(1, 2.5) Line segment ab is a tangent to circle o at point b. Which type of triangle is always formed when points a,b and o are connected?. Steve approached Takumi after math class to see if he could get some help with his homework. He sought out Takumi because he is Asian American and so Steve assumed that he must be really good at math. Steve's belief about Takumi's skills is known as a: I need help. Whats the answer? Many people do not live good lives in their home countries. hey will you be a friend to my best her name is alexzicancelperez she has only one friend and that me can please be her friend anyone help me 50 points no links plswhat are 3 Events during the eruption of Mount Vesuvius What is the meaning of the poem of sacagawea ? Answer this question! a mechanism for evolution in nature Help me out pleasePopular Sovereignty is established in the Preamble of the Constitution. What does Popular Sovereignty mean? A) Federalism - sharing power between the people and the government. B) Federalism - sharing power between the state and national government. C) The constitution rules the people.D) The people give consent to be ruled. who founded the universal negro improvement association Consider the triangle shown. Which shows the sides in order from longest to shortest?. This term describes not having money but the ability to provide land and other resources. Electrical bonding refunding quick check!! A team wants to understand the effects of molecular weight on boiling point. The team has access to five substances withdifferent molecular weights and the time to measure 50 boiling points. How can the team make the best use of the laboratorytesting time? (1 point)O by taking 10 measurements of each of the five liquids and using the highest value from each setO by taking 10 measurements of each of the five liquids and finding an averageO by taking measurements of the liquids one at a time, making sure that the correct results are achieved beforemoving on to another liquidO by taking one measurement of each liquid and then working to improve the least certain liquid in the group Mark sews at a constant rate. He stitches 5 pillows in 8 minutes. What is the constant of proportionality for the relation of pillow to hours. The weights of a certain brand of candies are normally distributed with a mean weight of 0.8593 g and a standard deviation of 0.0511 g. A sample of these candies came from a package containing 464 candies, and the package label stated that the net weight is 396.1 g. (If every package has 464 candies, the mean weight of the candies must exceed 396.1 464=0.8537 g for the net contents to weigh at least 396.1 g.) what is it called when a snowman has a temper tantrum Is a baby bird a bird that's a baby, or a baby that's a bird?If you can answer this, then you are the smartest person