Colin loves to eat tuna salad for lunch. His mom is always looking for a bargain on 12-ounce cans of tuna. Today, his local grocery store is offering 4 cans of Sea Star tuna for $3.28 and 2 cans of Ocean's Best tuna for $1.88. Which brand is the better deal?​

Answers

Answer 1
Sea star tuna is a better bargain for 82 cents a can. Oceans best tuna is 94 cents a can.

Related Questions

How are different types of linear equations similar and how are they different

Answers

Answer:

The graph of linear inequalities include a dashed line if they are greater than or less than but not equal to. Linear equations, on the other hand, include a solid line in every situation. Moreover, linear inequalities include shaded regions whereas linear equations do not.

Step-by-step explanation:

Help Me Pls

1.Virgie will equally give P 742.60 among her 4 nephews. How much will each nephew get?

A. P 185.65
B. P 85.56
C. P 158.65
D. P185.55

2.Php 5876 are distributed equally among 26 men. How much money will each person
get?

D.P 262
C. P 262
B. P 226
A. P 225

3.Bernard wants to cut a straight board into 4 equal pieces. The board is 112.12 cm
long. How long should Bemard cut each piece?

D. 28.04
C. 28.03
B. 28.02
A. 28.01

4.When the in a basket is grouped into 2, 3 or 5, there is always an extra.

5.How many 25centavo coins are equal to P 5.00?
D. 18
C. 21
B. 19
A. 20​

Answers

The amount that will be gotten by each nephew when Virgie will equally give P 742.60 among her 4 nephews will be $185.65.

Since Virgie will equally give P 742.60 among her 4 nephews, the amount that each nephew gets will be:

= 742.60 / 4

= $185.65

If Php 5876 are distributed equally among 26 men, the amount that each person gets will be:

= Php 5876 / 26

= Php 226

If Bernard wants to cut a straight board into 4 equal pieces and the board is 112.12 cm, the length of each piece will be:

= 112.12cm / 4

= 28.03cm

The number of 25cents coins that are equal to P 5.00 will be:

= 5/0.25

= 20

There will be 20 25 cents coins on P5.00.

Read related link on:

https://brainly.com/question/25311950

If m∠12 = 117° and m∠5 = 51°, find each measure.

m∠1 = º m∠8 = º


m∠2 = º m∠9 = º


m∠3 = º m∠10 = º


m∠4 = º m∠11 = º


m∠6 = º m∠13 = º


m∠7 = º m∠14 = º

Answers

Answer:90

Step-by-step explanation:

Assume that adults have IQ scores that are normally distributed with a mean of ?=100 and a standard deviation ?=20. Find the probability that a randomly selected adult has an IQ less than 140.

Answers

Answer:

The probability that a randomly selected adult has an IQ less than 140 is 0.9772

Step-by-step explanation:

Given:

Standard deviation: σ=20

Mean: μ=100

P(X<140)=?

Calculate:

normalcdf(lower,higher,μ,σ) = normalcdf(0,140,100,20) = 0.9772496509 ≈ 0.9772 ≈ 97.72%

need help with this algebra ii question

Answers

Vertex form: y = |x - h| + k

Vertex = (h, k)

G(x) was shifted 3 to the right and up 2.

G(x) = |x - 3| + 2

Hope this helps!! :)

HELP ME, THE MIDPOINT OF AB IS M (-4,-7). If the coordinates of A are (-7,-6) what are the coordinates of B?

Answers

Answer:

(-1,-8)

Step-by-step explanation:

Multiply each value of midpoint by 2 and take away given points coordinates

Explain how multiplying with 6 is like multiplying with 3.

Answers

Answer:

Step-by-step explanation:

lets say 6 times 6 =36

3 is a half of six so if you

      6x6=36

     3x6=18

I have more question then this one

Answers

The last option is correct

PLS HELppppppppppppppp

Answers

Answer: B

Step-by-step explanation:

Oki so I know this becaue I study to much and because if there was an answer saying this : y=6x+3 it would be wrong because it is adding to the constant

So y=6x is proportinal because it is allways constant. I forgot this was an example sorry.

Answer:

B. since x can equal anything, but nine is in front therefore, it can be what you want, so it is B.

Which graph shows a system with one solution?

Answers

Answer: Graph A

Explanation:

A solution is where the lines intersect. Graph A shows exactly one solution, and it is at (-2,2)

Graph B doesn't have any solutions since the lines are parallel, and parallel lines never intersect. We consider this system to be inconsistent.

Graph C has infinitely many solutions. The two lines perfectly overlap, meaning there are infinitely many intersection points. All solutions here are of the form (x,y) = (x,2x-1)

Divide x4+2x2−24
by x+2

Answers

[tex]\begin{array}{c|c}_{-}\ x^4+2x^2-24 &\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\! \underline{ x+2 } \\ \!\!\!\!\!\!\!\!\!\!\! \underline{x^4+2x^3}& x^3-2x^2+4x-8 \\{ \big{_{-}}}-2x^3-24& \\\underline{-2x^3-4x^2}& \\ _{-} \ 4x^2-24 & \\ \underline{4x^2+8x}& \\ _{-}-8x-24& \\ \underline{-8x-16} & \\ -8 &\end {array }[/tex]

[tex]\displaystyle \frac{x^4+2x^2-24}{x+2} =x^3-2x^2+4x-8 -\frac{8}{x+2}[/tex]

How to type a line above the number 6 on chromebook.

Answers

Answer:

you put in the number 6 but you leave room uptop so enter and then put 6 for the----- so in other words

-----

6

How can you compare data sets?

Answers

Answer:

Grapgical charts and data plots

Step-by-step explanation:

Graphically.

Spread.

Shape.

Unusual features.

Step-by-step explanation:

Hope it helps you!!

What will NEVER change?
In a sequence of translations, reflections, and rotations,
what will NEVER change from the pre-image to the
image?
(Select all that apply)
The lengths of the line segments.
T
The position of the object.
The measures of the angles.
The orientation of the object.

Answers

Answer:

Step-by-step explanation:

the lengths of the line segments

Two mechanics worked on a car. The first mechanic worked for 10 hours, and the second mechanic worked for 5 hours. Together they charged a total of $950. What was the rate charged per hour by each mechanic if the sum of the two rates was $125 per hour?

Answers

Answer:

First mechanic: $65.

Second mechanic: $60.

Step-by-step explanation:

Let the rates be x for the first mechanic and y for the second.

x + y = 125

10x + 5y = 950

Multiply first equation by - 5

-5x - 5y = -625

Adding the last 2 equations:

5x = 325

x = 65

y = 125-65 = 60 .

write the rational expressions as equivalent rational expressions with the lowest common denominator

Answers

1. The equivalent rational expression with the lowest common denominator of   [tex]\frac{2}{3d^{2} + 14d^{2} - 5 }[/tex]   is [tex]\frac{2}{(d+5)(3d-1)}[/tex]

2. The equivalent rational expression with the lowest common denominator of [tex]\frac{3d}{3d^{2} - 22d + 7}[/tex]  is [tex]\frac{3d}{(d-7)(3d-1)}[/tex]

1.

  [tex]\frac{2}{3d^{2} + 14d^{2} - 5 }[/tex]

Let factorise the denominator below

3d² + 14d - 5

-15 and 14

Two numbers we can multiply to get -15 and add to get 14 are 15 and -1.

Therefore,

3d²- d + 15d - 5

d(3d - 1) + 5(3d - 1)

(d+5)(3d-1)

Therefore, the equivalent rational expression with the lowest common denominator will be

[tex]\frac{2}{(d+5)(3d-1)}[/tex]

2.

[tex]\frac{3d}{3d^{2} - 22d + 7}[/tex]

Factorise the denominator

3d²- 22d+7

3d²- d - 21d + 7

d(3d - 1) - 7(3d - 1)

(d - 7)(3d - 1)

Therefore, the equivalent rational expression with the lowest common denominator will be

[tex]\frac{3d}{(d-7)(3d-1)}[/tex]

read more here: https://brainly.com/question/19756399?referrer=searchResults

For this function: f(x)=I-3x-1I
find each of the following:
a. f(-1)
b. f(0)
c. f(3)

Answers

Step-by-step explanation:

a. f(-1)=(3-1)

=2

b.f(0)=(0-1)

=-1

c.f(3)=(-9-1)

=-10

A farmer has 15 boxes of eggs
There are 6 eggs in each box.
Write, as a ratio, the number of eggs in three boxes to the total number of eggs.
Give your answer in its simplest form
Total

Answers

A farmer has 15 boxes of eggs and there are 6 eggs in each box. Therefore it will be part to whole. The bigger number is always the whole. 6:15 is the ratio.

5+55+55+55+55+55+55+55+55+55+55+55+5/0=free

Answers

Answer:

Thanks man

Step-by-step explanation:

Answer:

thx

Step-by-step explanation:

Hello who here is good at math i need help
if you can help me with some assignments then please do

Answers

Answer:

sup

Step-by-step explanation:

whats your question

The cost of 6 sandwiches and 4 drinks is $53. The cost of 4 sandwiches and 6 drinks is $47.
How much does one sandwich cost?

A. $5.30
B. $3.50
C. $4.50
D. $6.50

Answers

D each sandwich coast $6.50

Answer:

look at the photo..........

1. Hoang currently requires $1000 per week to maintain his lifestyle. Assuming inflation
averages 2% per year, how much will Hoang require per week to maintain his current
lifestyle in:
a. 10 years' time:
U..=1000
b. 20 years' time:
C. 30 years' time:

Answers

Using an exponential function, we have that:

a) In 10 years, the amount needed will be of $1,219 per week.

b) In 20 years, the amount needed will be of $1,486 per week.

c) In 30 years, the amount needed will be of $1,811 per week.

An increasing exponential function has the following format:

[tex]A(t) = A(0)(1 + r)^t[/tex]

In which:

A(0) is the initial value.r is the rate of change, as a decimal.

In this problem:

Currently requires $1000, thus [tex]A(0) = 1000[/tex].Inflation of 2% per year, thus [tex]r = 0.02[/tex]

Then, his weekly amount needed is going to be given by:

[tex]A(t) = A(0)(1 + r)^t[/tex]

[tex]A(t) = 1000(1 + 0.02)^t[/tex]

[tex]A(t) = 1000(1.02)^t[/tex]

Item a:

In 10 years, we have that:

[tex]A(10) = 1000(1.02)^{10} = 1219[/tex]

In 10 years, the amount needed will be of $1,219 per week.

Item b:

In 20 years, we have that:

[tex]A(20) = 1000(1.02)^{20} = 1486[/tex]

In 20 years, the amount needed will be of $1,486 per week.

Item c:

In 30 years, we have that:

[tex]A(30) = 1000(1.02)^{30} = 1811[/tex]

In 30 years, the amount needed will be of $1,811 per week.

A similar problem is given at https://brainly.com/question/21942338

x / 2.5 = 10
plz helppp

Answers

Answer:

x=25

Step-by-step explanation:

EASY PLEASE HELP HELP


Write the scale without units: 1 cm:1 km

Answers

Answer:

1:1

Step-by-step explanation:

thats how you write scale

mark brainliest pls

What does 1/2 + 1/4 equal

Answers

3/4.
1/2 is the same thing as 2/4. 2/4 plus 1/4 equals 3/4

Answer:

0.75 as a decimal, and 3/4 as a fraction

Step-by-step explanation:

Can you please tell me the answer please

Answers

Answer:

34°

Step-by-step explanation:

21x - 1 + 11x +1 + 26x + 6 = 180

58x -1 +1 +6 = 180

58x +6 = 180

58x = 174

x = 3

11 × 3 + 1 = 34

solve pls brainliest

Answers

Step-by-step explanation:

-181+485=304

-146-(-181)=35

which of the following statements are true for sin (-430°)

i. the basic angle, a lies in the second quadrant
Ii. sin (-430°) = +sin (430°)
III. sin (-430°) = sin (70°)
iv. a = 30°​

Answers

Answer:

Step-by-step explanation:

sin(-430)=-sin(430)=-sin(360+70)=-sin 70

Sociologists say that 85% of married women claim that their husband's mother is the biggest bone of contention in their marriages (sex and money are lower-rated areas of contention). Suppose that six married women are having coffee together one morning. Find the following probabilities. (Round your answers to three decimal places.)
(a) All of them dislike their mother-in-law.

Incorrect: Your answer is incorrect.


(b) None of them dislike their mother-in-law.


(c) At least four of them dislike their mother-in-law.


(d) No more than three of them dislike their mother-in-law.

Answers

The probability is equal to 0.9788.

We have given that,

Sociologists say that 85% of married women claim that their husband's mother is the biggest bone of contention in their marriages (sex and money are lower-rated areas of contention). Suppose that six married women are having coffee together one morning.

We have to find the probability

Probability all dislike is

[tex]0.85^8= 0.27[/tex]

What is the probability?

Probability is the branch of mathematics concerning numerical descriptions of how likely an event is to occur, or how likely it is that a proposition is true. The probability of an event is a number between 0 and 1, where, roughly speaking, 0 indicates the impossibility of the event and 1 indicates certainty.

The probability that none dislike is,

[tex]0.15^8= 2.6 \times 10^{(-7)}[/tex]

At least 5 dislike

5 dislike 8C5

[tex](0.85)^5(0.15)^3= 0.0839[/tex]

6 dislike 8C6

[tex](0.85^6 0.15)^2= 0.2376[/tex]

7 dislike

[tex]8*(0.85^7) (0.15)=0.3848[/tex]

8 dislike

[tex]0.85^8= 0.2725[/tex]

Therefore the probability is equal to 0.9788.

To learn more about the probability visit:

https://brainly.com/question/25870256

#SPJ1

Solve for y.
y-x= 11
x= 12
y=

Answers

Answer:

y=23

Step-by-step explanation:

y-x=11

x=12

y=x+11

y=12+11

y=23

Other Questions
This is my cat but literally no one in my family knows what type of breed she is, she was always really small and finally started to actually grow about a year ago, her eyes are green also they are really pretty, I think shes pretty young b/c she tends to have a lot of energy and do more then our old black cat, we had an older cat who looked exactly like her but was way bigger, anyone know how to be able to figure out what kind of breed she is?(I dont knowwhat kind of subject this would be- so ima put a random one that has to do with science, sry if its the wrong one!) Anorexia Nervosa is an eating disorder characterized by the need to starve yourself.A. TrueB. False Help help!! Whats the setting of the witch by Shirley Jackson and how does it contribute to the story? ILL MARK BRAINLIST!! Traditional stock split definition Determinen las medidas algebraicas necesarias para calcular el rea del hexgono Microsoft Word is an example of which type of software?Question 5 options:Application softwareSystem softwareFirmwareAn operating system neon is a colorless gas that is not known to react with any other substance. which other element is most likely to be a nonreactive gas?A. F, number 9B. Na, number 11C. Xe, number 54D. Cs, number 55i need answer ASAP first one to give me the correct answer gets brainliest he ratio of the interior angle measures of a triangle is 2:3:5. What are the angle measures?In order from the smallest angle to the largest angle, the angle measures are,, and. what is the empirical formula of a compound that consists of 0.039 moles of iron atoms combined with 0.052 moles of oxygen atoms? Why did Job and his men fight in the Revolution There are 3 feet in 1 yard This is equivalent to 12 feet in 4 yards which proportion can be used to represent this?oft Juan is making a cake for his mom's birthday. For every three cups offlour, there are four teaspoons of sugar. If Juan used 33'cups of flour,how many teaspoons of sugar did he use? Be sure to identify themultiplicative rule. Select the correct answer.An archway is modeled by the equation y = -2x2 + 8x. A rod is to be placed across the archway at an angle defined by the equation x 2.23y + 10.34 = 0. If the rod is attached to the archway at points A and B, such that point B is at a higher level than point A, at what distance from the ground level is point B? A. 8 unitsB. 6 unitsC. 5 unitsD. 3 units Give an example of a number between 20 and 50 which is a multiple of 3 and also a factor of 84. Item 5 How many of the chemicals created when tobacco burns are known to cause cancer? about 30 about 50 about 70 about 90 If you divide 60 liters into 10 parts, there will be 6 liters each. How many liters would there be if you had 7 of these groups? A water dispenser has a capacity of 10,000 milliliters. What is its capacity in liters?Be sure to include the correct unit in your answer. Find the measure of the angles (S)Please help out:/ HELP PLEASE I NEED HOW TO DO IT AND THE ANSWER FAST PLEASE [tex]a\sqrt{a} +2a + \sqrt{a} +2\\[/tex]