classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2

Answers

Answer 1

The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.

A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.

In the reaction;

Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)

We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.

Learn more: https://brainly.com/question/5624100


Related Questions

Sinong pilipino dito kawaykaway naman kayo dyan haha​

Answers

Answer:

ako po because I'm pilipino

Explanation:

HAHAH same too

what mass of water (in grams) is produced by the reaction of 23.0 g of SiO2?

Answers

The mass of water produced by the reaction of the 23 g of [tex]SiO_2[/tex]  is 13.8 g.

The given chemical reaction;

[tex]4Hf (g) \ + \ SiO_2 (s) \ --> \ SiF_4(g) \ + \ 2H_2O(l)[/tex]

In the given compound above, we can deduce the following;

molecular mass of [tex]SiO_2[/tex] = 28 + (2 x 16) = 60 gmolecular mass of [tex]2H_2O[/tex] = 2(18) = 36 g

60 g of [tex]SiO_2[/tex]  --------- 36 g of water

23 g of [tex]SiO_2[/tex]  ------------- ? of water

[tex]mass \ of \ water = \frac{23 \times 36}{60} = 13.8 \ g \ of \ water[/tex]

Thus, the mass of water produced by the reaction of the 23 g of [tex]SiO_2[/tex]  is 13.8 g.

"Your question is not complete, it seems to be missing the following information";

In the reaction of the given compound, [tex]4Hf (g) \ + \ SiO_2 (s) \ --> \ SiF_4(g) \ + \ 2H_2O(l)[/tex], what mass of water (in grams) is produced by the reaction of 23.0 g of SiO2?

Learn more here:https://brainly.com/question/13644576

does ch3 have resonance structure?​

Answers

Answer:

yes

Explanation:

if u watch or look closely u will observe it

The CH₃ has resonance structures as it has odd number of hydrogen atoms.

In chemistry, resonance, also called mesomerism, is a way of describing bonding in certain molecules or polyatomic ions by the combination of several contributing structures ,also variously known as resonance structures or canonical structures into a resonance hybrid (or hybrid structure) in valence bond theory. It has particular value for analyzing delocalized electrons where the bonding cannot be expressed by one single Lewis structure.

Thus,  CH₃ has resonance structures as it has odd number of hydrogen atoms.

Learn more about resonance,here:

https://brainly.com/question/1511445

#SPJ3

60) Which of the following is a chemical property?
A) Sugar is a solid at room temperature.
B) Potassium reacts with water to form potassium hydroxide.
C) Sugar dissolves in water.
D) Gasoline and water do not mix.
.

Answers

Answer:

C is the answer. Sugar Dissolves in water

Explanation:

Brainliest Maybe

Sugar dissolves in water is a chemical property. Therefore, option C is correct.

What do you mean by chemical properties ?

Chemical properties describe a substance's characteristic ability to react to form new substances; they include flammability and corrosion susceptibility. A pure substance's chemical and physical properties are the same in all samples.

A chemical property is the ability or inability to change one type of matter into another. Chemical properties include flammability, toxicity, acidity, reactivity, and heat of combustion.

A chemical property explain the ability of a substance to undergo a specific chemical change. To verify a chemical property, we look for a chemical change.

Thus, Sugar dissolves in water is a chemical property, option C is correct.

To learn more about the chemical property, follow the link;

https://brainly.com/question/1935242

#SPJ2

define the term chemotherapy.​

Answers

I'm not able to understand that what is written in the pic.. As I can't understand this language..

Treatment that uses drugs to stop the growth of cancer cells, either by killing the cells or by stopping them from dividing. Chemotherapy may be given by mouth, injection, or infusion, or on the skin, depending on the type and stage of the cancer being treated.


1. How many MOLECULES are contained in 80.0 grams of sodium hydroxide?

Answers

Answer:

2 molecules

Explanation:

In 80 grams there will be 2 molecules of NaOH, so mass of Sodium would be 23 x 2 = 46g.

Butanoic acid + 2 propanol

Answers

Answer:

Butanoic acid and 2-propanol reacts to form isopropyl butyrate.

Explanation:

brainliest plz

What happens to excess heat produced in the muscle during contraction and relaxation

Answers

Answer:

Calcium is then pumped back into the sarcoplasmic reticulum breaking the link between actin and myosin.

Explanation:

Actin and myosin return to their unbound state causing the muscle to relax. Alternatively relaxation (failure) will also occur when ATP is no longer available.

Why is mining for coal a long-term concern?

A. It is being replenished faster than it can be mined.
B. The supply will eventually be exhausted.
C. New methods of mining need to be developed.
D. The demand for coal is diminishing.

Answers

Answer: Is B: the supply will eventually be exhausted.

Explanation:

there is only so much coal in the world as in many other elements. That is why we are looking for more appropriate and resourceful way of supplying energy and it is a lot safer for the workers involved

As coal is a nonrenewable source of energy so its supply will eventually be exhausted. Therefore, option (B) is correct.

What are nonrenewable sources of energy?

Non-renewable energy can be described as energy that comes from fossil fuels such as coal, natural gas, crude oil, and uranium. Non-renewable energy requires human intervention to create it suitable for consumption. Fossil fuels are generally made up of Carbon. Fossil fuels were produced over 300 million years ago.

Non-renewable energy is generally fossil fuels such as coal, oil, natural gas, etc. Fossil Fuels are produced from the remains of animals and plants and can be is divided into three categories.

To produce natural gas from fossil fuels, the decomposition process is longer and conducted with high amounts of pressure and heat. Coal takes millions of years under the crust of the earth to produce through the decomposition of trees, plants, and ferns.

Learn more about nonrenewable sources of energy, here:

https://brainly.com/question/10402348

#SPJ2

How many moles of Magnesium(Mg) are
in 2.46 x 10^28 atoms of Magnesium?

Answers

so 2.46 X 10^28 contains (2.46 X 10^28)/(6.02 X 10^23) =

(2.46 X 10 X 10^27)/ (6.02 x(10^23) = (24.6/6.02) X 10^ (27-23)=

4.09 X 10^4 = 40,900

Answer:

4.09 X 10^4 = 40,900 moles

Explanation:

How many moles of Magnesium(Mg) are

in 2.46 x 10^28 atoms of Magnesium?

PLEASE LEARN THIS FUNDAMENTAL RULE OF CHEMISTRY...1 MOLE OF ANYTHING CONTAINS AVOGADROS NUMBER OF PARTICLES}

6.02 X 10^23.09

so 2.46 X 10^28 contains in moles(2.46 X 10^28)/(6.02 X 10^23) =

(2.46 X 10 X 10^27)/ (6.02 x(10^23) = (24.6/6.02) X 10^ (27-23)=

4.09 X 10^4 = 40,900 moles

Guy’s pleaseeee help

Answers

Answer:

A. All isotopes have no charge

PLEASE HELP!!!!! WILL GIVE BRAINLIEST!!!!

Answers

The answer should be A

VisibleVisible wave length visible wavelength of light that are emitted by Adams can be used to get Nate explosive devices remotely

When a sample of iron ore of mass 2.016 g is treated with 50.0 mL of hydrochloric acid, the iron dissolves in the acid to form a solution of . The solution is diluted to 100.0 mL and the concentration of ions is determined by spectrometry to be . What is the mass percentage of iron in the ore

Answers

The mass percentage of iron in the ores is 0.05036 g Fe2+

s
Part B
Refer to the observations of the test tubes from part A. Determine which metal (or hydrogen) in each test tube is
more reactive. Remember that the less reactive metal (or hydrogen) will typically end up in pure form as an
element, so no reaction will occur if the less reactive metal (or hydrogen) is the one that begins in pure form

Answers

Answer:

More Reactive:

iron

hydrogen

zinc

magnesium

zinc

iron

Explanation:

The reactivity of metals can be determined based on their ability to displace other metals from their compounds or to displace hydrogen from acids. Generally, metals that are higher in the reactivity series can displace metals lower in the series.

1. **Iron & Copper:** Iron is more reactive than copper. If iron is present in its pure form, it would displace copper from its compound.

2. **Copper & Hydrogen:** Hydrogen is less reactive than copper. No reaction will occur if hydrogen is the element in pure form.

3. **Zinc & Iron:** Zinc is more reactive than iron. If zinc is present in its pure form, it would displace iron from its compound.

4. **Iron & Magnesium:** Magnesium is more reactive than iron. If magnesium is present in its pure form, it would displace iron from its compound.

5. **Zinc & Hydrogen:** Hydrogen is less reactive than zinc. No reaction will occur if hydrogen is the element in pure form.

6. **Iron & Hydrogen:** Hydrogen is less reactive than iron. No reaction will occur if hydrogen is the element in pure form.

Remember, the reactivity series is a ranking of metals based on their tendency to lose electrons and form positive ions. Elements higher in the series can displace elements lower in the series from their compounds in certain reactions.

To know more about reactivity of metal:

https://brainly.com/question/20570629

#SPJ3

How many grams of pure aluminum could be produced from 999 g of aluminum oxide?

Answers

Answer:

Explanation:

First, calculate the molar mass of Aluminum Oxide (Al2O3), by multiplying the number of the constituent atoms, by their relative atomic abundances . Inserting the atomic masses into the equation gives you  . Then find the percent of Aluminum by mass, in Aluminum Oxide.  Finally, set up an equality, where 53.02% of the mass of Aluminum Oxide, is 999 grams of Aluminum

What Group is this atom located use a number only
*

Answers

7 count the dots in the middle for you answer and if not it’s 3

The water in a fishery became polluted when toxic waste was dumped into its pond, causing the fish population to substantially decline. The percents of fish that survived are recorded in the table.
Day 1 2 3 4 5
% Survival 79 55 38 31 19


a) What is the order of the reaction live fish ------> dead fish?

b) What is the rate constant?

c) If the fish continue to die at this rate, how many fish will be alive after 10 days?

Answers

In the pond, the percentage of fish left after ten days is 4%.

Given that;

N(t) = Noe^-kt

Where;

N(t) = percentage of fish at time t

No = Initial percentage of fish

k = rate constant

t = time taken

Given that we had 100% fish population at the beginning, we can see that this reaction is first order.

The rate constant is obtained from;

When t = 5

19 = 100e^-5k

19/100 =e^-5k

0.19 = e^-5k

ln 0.19 = -5k

k = ln (0.19)/-5

k = 0.33

In ten days;

N(10) = 100e^-0.33(10)

N(10) = 4%

Learn more: https://brainly.com/question/5624100

Calculate the concentrations of all species in a 0.100 M Na2CO3 solution.

Answers

The concentrations of all species in a 0.100 M Na₂CO₃ are:  

1. The concentration of Na⁺ in the solution is 0.2 M.

2. The concentration of CO₃²¯ in the solution is 0.1 M

We'll begin by writing the dissociation equation for Na₂CO₃. This is illustrated below:

Na₂CO₃(aq) —> 2Na⁺(aq) + CO₃²¯(aq)

Thus, the species in Na₂CO₃ are Na⁺ and CO₃²¯

From the balanced equation above,

1 mole of Na₂CO₃ contains 2 moles Na⁺ and 1 mole of CO₃²¯

1. Determination of the concentration of Na⁺.

From the balanced equation above,

1 mole of Na₂CO₃ contains 2 moles Na⁺

Therefore,

0.100 M Na₂CO₃ will contains = 2 × 0.1 = 0.2 M Na⁺

Thus, the concentration of Na⁺ in the solution is 0.2 M.

2. Determination of the concentration of CO₃²¯

1 mole of Na₂CO₃ contains 1 mole of CO₃²¯

Therefore,

0.100 M Na₂CO₃ will also contains 0.100 M CO₃²¯

Thus, the concentration of CO₃²¯ in the solution is 0.1 M

Learn more: https://brainly.com/question/23941053

What is surface tension and why is it important?

Answers

Answer:

What is surface tension?

Explanation:

Surface tension and droplets: Surface tension is responsible for the shape of liquid droplets. Although easily deformed, droplets of water tend to be pulled into a spherical shape by the cohesive forces of the surface layer.

Surface tension forces between mucosal surfaces play an important role in the pathogenesis of the disease. The obstruction of upper airway elicit the activation of autonomic nervous system, hypoxemia, and arousal from sleep.

Hope it helps

Some chemicals, most often inorganic salts, in the laboratory have the nasty tendency to absorb water from the atmosphere. This property is called hygroscopicity. Anhydrous (water-free) Cupric Perchlorate [Cu (ClO4)2] weighs 262.447g/mol, but after sitting on out on the bench top absorbs water from the air and now weighs 370.540g/mol. How many water molecules did our Cupric Perchlorate absorb?

Answers

If an anhydrous Cupric Perchlorate weighs 262.447g/mol initially and weighs 370.540 g/mol after sitting on the bench to absorb water from the air, the number of water molecules absorbed would be 6 moles.

First, let us calculate the amount of water gained during the course of staying on the bench:

Water gained = weight after gaining water - initial weight

                       =  370.540 - 262.447

                        = 108.093g/mole

The total amount of water gained per mol is 108.093. Each water molecule weighs 18.015 g/mole. Thus, the total number of water molecules that will sum up to 108.093 would be:

                         108.093/18.015 = 6 moles

In other words, the number of water molecules absorbed by the Cupric Perchlorate is 6 moles.

More on calculating water of hydration can be found here: https://brainly.com/question/919417

                       

need help :( number 5 and 6​

Answers

So for number 5.

The genesis of a poem for me is usually a cluster of words. The only good metaphor I can think of is a scientific one: dipping a thread into a supersaturated solution to induce crystal formation. I don't think I solve problems in my poetry; I think I uncover the problems.

Number 6.
Unsaturated solutions: found in the vast majority of solutions. eg. blood, soda, alcoholic drinks, cell sap, battery acid.

Supersaturated solutions: invert sugar (a mixture of glucose and fructose), gasses dissolved in crude oil when it is still untapped, some clouds (those that cause cloudbursts).

saturated solution: the carbon dioxide dissolved in sodas (unopened), nitrogen in the air in the earth.


Describe the structure and bonding in aluminium metal.

Answers

Answer: Metallic bonding.

Explanation: Aluminum forms metallic bonds with itself. This results in a metallic lattice structure.

Aluminum is found in the 13 group of periodic table and it mostly forms ionic bonds with metal. The structure of Aluminum is Orthorhombic mainly.

What is element?

Element generally consist of atoms or we can atoms combine to form element. Atoms of an element is always same, means all the properties of all atoms of one type of element is same. Two or more than two atoms with different physical or chemical properties can not combine together to form an element.

The structure of Aluminum is Orthorhombic and it contains high neutron capture cross section. It is very stable in dry air but oxidizes in moist air. It reacts with oxygen to form Al₂O₃.Valence of Aluminum is III. Its electronic configuration is  [Ar]3d¹⁰ 4s² 4p¹

Thus  structure of Aluminum is Orthorhombic and metallic bond is formed by Aluminum

To know more about element, here:

https://brainly.com/question/8460633

#SPJ2

What is a polyprotic buffer?

Answers

Buffers - mixtures of conjugate acid and conjugate base at ±1 pH unit from pH = pKa. Resistant to changes in pH in response to small additions of H+ or OH-. ... Polyprotic acids - dissociation of each H+ can be treated separately if the pKa values are different

Models are used to predict behaviors in the real world.
True
False

Answers

True
It’s true because models are based on real world problems to help grasp a understanding of the problem

how are the results of the crosses differ if the red allele was dominant over the white allele? Explain both of the F¹ and F² generations​

Answers

Answer:

if the red allele is dominant 3 out of 4 offspring will have the red characteristic and 1 out of 4 will have white characteristic

Write the full electron configuration for a Ca+ ion.

Answers

Answer:

[Ar] 4s²

Explanation:

The full electron configuration for the Ca+ ion is:

1s² 2s² 2p⁶ 3s² 3p⁶.

How to determine the electron configuration for the Ca+ ion

To determine the full electron configuration for a Ca+ ion, we need to remove one electron from the neutral calcium atom (Ca). The neutral calcium atom has the electron configuration: 1s² 2s² 2p⁶ 3s² 3p⁶ 4s².

When Ca loses one electron to form the Ca+ ion, the electron removed comes from the highest energy level, which is the 4s orbital.

Therefore, the full electron configuration for the Ca+ ion is:

1s² 2s² 2p⁶ 3s² 3p⁶.

Learn more about electron configuration at https://brainly.com/question/26084288

#SPJ6

Please solve this question

Answers

Answer:

what question?

Explanation:

What physical and chemical properties would an antique dealer use to determine the substance that makes up a
piece of jewelry?

Answers

Answer:

Characteristics such as melting point, boiling point, density, solubility, color, odor, etc. are physical properties. Properties that describe how a substance changes identity to produce a new substance are chemical properties. ... Physical and chemical properties can be used to classify a substance as ionic or molecular.

The temperature at which a solid melts is the same as the temperature at which its liquid form solidifies (true or false)​

Answers

its false not true................

Answer:

True

Explanation:

This is true because, upon cooling the particles in a liquid loses energy, stops moving and remains constant and the forms a solid.

Therefore we can say the freezing point and melting point occurs at the same temperature

Carbon has three isotopes: carbon-12, carbon 13, and carbon-14. If the average atomic mass on the
periodic table for carbon is 12.011 amu, which isotope is most abundant? Explain your answer using a complete sentence.

Answers

Answer

The most abundant carbon isotope is carbon-12

Explanation:

The relative atomic mass of carbon is 12.011, which is extremely close to 12.0. This means that the masses C-13, and C-14 are practically negligible when contributing to the relative atomic mass of carbon.

In fact, the C-12 isotope makes up 98.9% of carbon atoms, C-13 makes up 1.1% of carbon atoms, and C-14 makes up just a trace of carbon atoms as they are found in nature.

Other Questions
what are the four organs of the integumentary system weight is a flawed measure of mass because it.... PLEASE ANSWER BY 10/30/21 or a. s. a. p. i needed to write something long enough to post this a 24-v battery is powering a light bulb with a resistance of 3.0 ohms. what is the current flowing through the bulb? Whoever can make the best sentence about ramen I'll give brainiest and 20 points. OMGGGGG!!! IM SO PROUD OF MYSELFFFF!!! Please help! Will mark brainliest if its the correct answer! Its also not C or D, I tried those out and it wasnt that (I have one more attempt left) Can someone please help as I'm not sure how to tackle this step by step? Especially question b, d, g, j, k, l. Not how sure to do it if contains a surd just on its own. so far , a storm has traveled 35 miles in 1/2 hour. if its currently 5:00pm and the storm is 105 miles away from you , at what time will the storm reach you ? explain your answer A lightbulb consumes 1440 watt-hours Per day how many watt-hours does it consume in three days and 12 hours? Someone help me I will make you Brainly 3,047.092 in expanded form. Susan is excited to learn various safe ways to browse the Internet. She is looking for suggestions that would help her. Which are the valid suggestions for Susan? The Internet is a medium used by numerous individuals. As a user of it, the responsibility of privacy and security rests with the user. Susan should be aware of the potential risks associated with improper use of the Internet. She should hence share her Social Security number whenever asked for it. She should be careful when using third-party applications and download applications from trusted and secure sites only. Susan should also be careful while using social networking websites. Susan should update her location information whenever possible. She should not click on any unknown links and use secure browsing and strong passwords. An example of a strong password is susanishere. I NEED THE RIGHT ANSWER ASAP NO LINKS !!! When were the Aryans in the Indus RiverValley?A. 4000 BCEB. 3000 BCEC. 2600 BCED. 1000 BCE An insect's head accounts for approximately 60% of its total mass. If the insect weighs 40 g, what is the massof its head? Que forma geomtrica tiene el continente americano How much will you pay in all for the $78 lunch bill with a 15% tip ? The difference between a number and 22 is equal to the number times 11. - The weight of 72 identical marbles is 183.6 grams. What is the weight of each marble? Explain how youknow the decimal point of your quotient is placed reasonably.